2-(16-acetoxy-5,14-dimethyl-3-oxo-4,5,6,7,8,9,10,11,12,13,14,15,16,17-tetradecahydro-3H-cyclopenta[a]phenanthren-16-yl)-2-oxoethyl furan-2-carboxylate

ID: ALA4539964

PubChem CID: 155549770

Max Phase: Preclinical

Molecular Formula: C28H34O7

Molecular Weight: 482.57

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(=O)OC1(C(=O)COC(=O)c2ccco2)CC2CCC3C4C=CC(=O)CC4(C)CCC3C2(C)C1

Standard InChI:  InChI=1S/C28H34O7/c1-17(29)35-28(24(31)15-34-25(32)23-5-4-12-33-23)13-18-6-8-20-21-9-7-19(30)14-26(21,2)11-10-22(20)27(18,3)16-28/h4-5,7,9,12,18,20-22H,6,8,10-11,13-16H2,1-3H3

Standard InChI Key:  AQAJRIFORUJTLQ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 35 39  0  0  0  0  0  0  0  0999 V2000
   15.7371  -21.2882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7371  -22.1054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4424  -22.5099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4424  -20.8755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1477  -21.2882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1442  -22.1054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8463  -22.5147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5563  -22.1114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8532  -20.8804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5559  -21.2967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5726  -19.6661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8585  -20.0659    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2754  -20.0824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2665  -20.8962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0377  -21.1561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5233  -20.5030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0520  -19.8395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0300  -22.5151    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.8461  -21.6886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2618  -21.7133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3089  -20.7104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0984  -19.9180    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.8802  -19.1305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4531  -18.5478    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.0891  -18.9257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5232  -21.4990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8846  -20.1305    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.9475  -22.0789    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.1618  -22.8675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5860  -23.4474    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.9519  -23.0762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2470  -23.8343    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.0629  -23.7886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2716  -22.9984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5846  -22.5559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  4  2  0
  2  3  1  0
  3  6  1  0
  5  4  1  0
  5  6  1  0
  5  9  1  0
  6  7  1  0
  7  8  1  0
  8 10  1  0
  9 10  1  0
  9 12  1  0
 10 14  1  0
 13 11  1  0
 11 12  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 13  1  0
  2 18  2  0
  6 19  1  0
 14 20  1  0
 16 21  1  0
 16 22  1  0
 22 23  1  0
 23 24  2  0
 23 25  1  0
 21 26  1  0
 21 27  2  0
 26 28  1  0
 28 29  1  0
 29 30  2  0
 29 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  2  0
 34 35  1  0
 35 31  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4539964

    ---

Associated Targets(Human)

ENPP2 Tchem Autotaxin (2645 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 482.57Molecular Weight (Monoisotopic): 482.2305AlogP: 4.70#Rotatable Bonds: 5
Polar Surface Area: 99.88Molecular Species: NEUTRALHBA: 7HBD:
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 4.47CX LogD: 4.47
Aromatic Rings: 1Heavy Atoms: 35QED Weighted: 0.56Np Likeness Score: 1.46

References

1. Ragle LE, Palanisamy DJ, Joe MJ, Stein RS, Norman DD, Tigyi G, Baker DL, Parrill AL..  (2016)  Discovery and synthetic optimization of a novel scaffold for hydrophobic tunnel-targeted autotaxin inhibition.,  24  (19): [PMID:27544588] [10.1016/j.bmc.2016.08.004]

Source