Propionic acid (1S,3R,5R)-1,3-diacetoxy-10-hydroxy-7,8-dimethyl-7-(3-methylene-pent-4-enyl)-3,5,6,6a,7,8,9,10-octahydro-2-oxa-cyclopenta[d]naphthalen-5-yl ester

ID: ALA4539996

PubChem CID: 155550020

Max Phase: Preclinical

Molecular Formula: C27H38O8

Molecular Weight: 490.59

Molecule Type: Unknown

Names and Identifiers

Canonical SMILES:  C=CC(=C)CCC1(C)C(C)CC(O)C23C(=C[C@H](OC(=O)CC)CC12)[C@@H](OC(C)=O)O[C@H]3OC(C)=O

Standard InChI:  InChI=1S/C27H38O8/c1-8-15(3)10-11-26(7)16(4)12-22(30)27-20(13-19(14-21(26)27)34-23(31)9-2)24(32-17(5)28)35-25(27)33-18(6)29/h8,13,16,19,21-22,24-25,30H,1,3,9-12,14H2,2,4-7H3/t16?,19-,21?,22?,24-,25+,26?,27?/m0/s1

Standard InChI Key:  NJOZTRHBLQOIOT-GFXJXTHCSA-N

Molfile:  

 
     RDKit          2D

 35 37  0  0  0  0  0  0  0  0999 V2000
   34.4458   -3.2625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8698   -4.0875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8698   -3.2625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1578   -2.8458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1578   -4.4958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4396   -4.0892    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8308   -4.6466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.1729   -5.3978    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.9929   -5.3045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0225   -4.4819    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.5501   -5.9130    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.4756   -5.0996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6673   -4.9348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.7372   -5.8821    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.3019   -6.6997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.0653   -7.0135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6142   -7.0843    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.1578   -2.0208    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.3333   -4.4167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.4249   -4.9458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5166   -5.0708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.6749   -4.6667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8181   -5.4676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.4207   -5.7708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.0082   -4.3583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.1331   -6.1869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.1289   -7.0120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.8413   -7.4280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.4125   -7.5387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.5579   -7.0191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.6128   -5.1660    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.8723   -1.6083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8723   -0.7833    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.5867   -2.0208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.3012   -1.6083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  6  2  0
  1  4  1  0
  5  2  1  0
  2  3  1  0
  3  4  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9  5  1  0
  7 10  1  6
  9 11  1  6
 10 12  1  0
 12 13  1  0
 12 14  2  0
 11 15  1  0
 15 16  1  0
 15 17  2  0
  4 18  1  6
  5 19  1  0
  2 20  1  0
 19 21  1  0
 21 22  1  0
 22 20  1  0
 22 23  1  0
 20 24  1  0
 20 25  1  0
 24 26  1  0
 26 27  1  0
 27 28  1  0
 27 29  2  0
 28 30  2  0
 19 31  1  0
 18 32  1  0
 32 33  2  0
 32 34  1  0
 34 35  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA4539996

   ---

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Unknown

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 490.59

Molecular Weight (Monoisotopic): 490.2567

AlogP: 3.98

#Rotatable Bonds: 8

Polar Surface Area: 108.36

Molecular Species: NEUTRAL

HBA: 8

HBD: 1

#RO5 Violations: ┄

HBA (Lipinski): 8

HBD (Lipinski): 1

#RO5 Violations (Lipinski): ┄

CX Acidic pKa: ┄

CX Basic pKa: ┄

CX LogP: 3.57

CX LogD: 3.57

Aromatic Rings: ┄

Heavy Atoms: 35

QED Weighted: 0.24

Np Likeness Score: 3.54

References

1. Cai S, Risinger AL, Petersen CL, Grkovic T, O'Keefe BR, Mooberry SL, Cichewicz RH..  (2019)  Anacolosins A-F and Corymbulosins X and Y, Clerodane Diterpenes from Anacolosa clarkii Exhibiting Cytotoxicity toward Pediatric Cancer Cell Lines.,  82  (4): [PMID:30830773] [10.1021/acs.jnatprod.8b01015]

Source

Source(1):

• Scientific Literature