The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-N-(4-(3-(3-Methoxyphenyl)acryloyl)phenyl)-6-methylthieno[2,3-b]quinoline-2-carboxamide ID: ALA4540070
PubChem CID: 155549841
Max Phase: Preclinical
Molecular Formula: C29H22N2O3S
Molecular Weight: 478.57
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1cccc(/C=C/C(=O)c2ccc(NC(=O)c3cc4cc5cc(C)ccc5nc4s3)cc2)c1
Standard InChI: InChI=1S/C29H22N2O3S/c1-18-6-12-25-21(14-18)16-22-17-27(35-29(22)31-25)28(33)30-23-10-8-20(9-11-23)26(32)13-7-19-4-3-5-24(15-19)34-2/h3-17H,1-2H3,(H,30,33)/b13-7+
Standard InChI Key: OROYVJGETKQDEB-NTUHNPAUSA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
16.3589 -17.0413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3578 -17.8608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0658 -18.2698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0640 -16.6324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7726 -17.0377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7734 -17.8567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4819 -18.2638 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.4764 -16.6275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1855 -17.0308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1931 -17.8499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9744 -18.0958 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
20.4498 -17.4286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9621 -16.7705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2669 -17.4210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6821 -18.1248 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.6689 -16.7095 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.4993 -18.1172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9097 -18.8219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7261 -18.8146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1289 -18.1025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7093 -17.3964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8943 -17.4071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9460 -18.0938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3622 -18.7971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3471 -17.3818 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.1793 -18.7884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5955 -19.4917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1933 -20.2010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6087 -20.9038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4268 -20.8955 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8276 -20.1785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4098 -19.4786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6447 -20.1669 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.0633 -20.8687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6511 -16.6329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 10 2 0
9 8 2 0
8 5 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 2 0
13 9 1 0
12 14 1 0
14 15 1 0
14 16 2 0
15 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
20 23 1 0
23 24 1 0
23 25 2 0
24 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
31 33 1 0
33 34 1 0
1 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 478.57Molecular Weight (Monoisotopic): 478.1351AlogP: 6.91#Rotatable Bonds: 6Polar Surface Area: 68.29Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.69CX Basic pKa: 3.90CX LogP: 6.87CX LogD: 6.87Aromatic Rings: 5Heavy Atoms: 35QED Weighted: 0.21Np Likeness Score: -1.26
References 1. Abdelbaset MS, Abdel-Aziz M, Ramadan M, Abdelrahman MH, Abbas Bukhari SN, Ali TFS, Abuo-Rahma GEA.. (2019) Discovery of novel thienoquinoline-2-carboxamide chalcone derivatives as antiproliferative EGFR tyrosine kinase inhibitors., 27 (6): [PMID:30744932 ] [10.1016/j.bmc.2019.02.012 ]