The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-Hydroxy-N-(3-methoxyphenethyl)-4-oxo-1,3-diphenyl-2-thioxo-1,2,3,4-tetrahydropyrimidine-5-carboxamide ID: ALA4540096
PubChem CID: 155550022
Max Phase: Preclinical
Molecular Formula: C26H23N3O4S
Molecular Weight: 473.55
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1cccc(CCNC(=O)c2c(O)n(-c3ccccc3)c(=S)n(-c3ccccc3)c2=O)c1
Standard InChI: InChI=1S/C26H23N3O4S/c1-33-21-14-8-9-18(17-21)15-16-27-23(30)22-24(31)28(19-10-4-2-5-11-19)26(34)29(25(22)32)20-12-6-3-7-13-20/h2-14,17,31H,15-16H2,1H3,(H,27,30)
Standard InChI Key: FAAJBIQQSAYADA-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
30.9872 -11.8369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2815 -10.6111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5757 -11.0197 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.2815 -12.2455 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.9872 -11.0197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5757 -11.8369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6930 -10.6111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4029 -11.0280 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.8617 -12.2455 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
30.2815 -9.7939 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.6930 -12.2455 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.6971 -9.7939 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.8678 -10.6115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8720 -9.7937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1648 -9.3856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4564 -9.7947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4595 -10.6161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1672 -11.0205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2808 -13.0614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5715 -13.4694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5711 -14.2859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2794 -14.6953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9894 -14.2823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9863 -13.4672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.1136 -10.6246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8182 -11.0384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5289 -10.6350 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2301 -11.0505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.9403 -10.6478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.9467 -9.8298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2371 -9.4161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5298 -9.8212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.6448 -11.0620 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.3556 -10.6589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 5 2 0
3 2 1 0
4 1 1 0
5 1 1 0
6 4 1 0
7 5 1 0
8 7 1 0
9 6 2 0
10 2 1 0
11 1 2 0
12 7 2 0
3 6 1 0
3 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
4 19 1 0
8 25 1 0
25 26 1 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
29 33 1 0
33 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 473.55Molecular Weight (Monoisotopic): 473.1409AlogP: 4.04#Rotatable Bonds: 7Polar Surface Area: 85.49Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 6.70CX Basic pKa: ┄CX LogP: 4.79CX LogD: 4.02Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.40Np Likeness Score: -0.82
References 1. Arencibia JM, Brindani N, Franco-Ulloa S, Nigro M, Kuriappan JA, Ottonello G, Bertozzi SM, Summa M, Girotto S, Bertorelli R, Armirotti A, De Vivo M.. (2020) Design, Synthesis, Dynamic Docking, Biochemical Characterization, and in Vivo Pharmacokinetics Studies of Novel Topoisomerase II Poisons with Promising Antiproliferative Activity., 63 (7): [PMID:32196342 ] [10.1021/acs.jmedchem.9b01760 ]