N-(1',2-dihydroxy-1,2'-binaphthyl-4'-yl)-4-fluorobenzenesulfonamide

ID: ALA4540111

PubChem CID: 2269814

Max Phase: Preclinical

Molecular Formula: C26H18FNO4S

Molecular Weight: 459.50

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=S(=O)(Nc1cc(-c2c(O)ccc3ccccc23)c(O)c2ccccc12)c1ccc(F)cc1

Standard InChI:  InChI=1S/C26H18FNO4S/c27-17-10-12-18(13-11-17)33(31,32)28-23-15-22(26(30)21-8-4-3-7-20(21)23)25-19-6-2-1-5-16(19)9-14-24(25)29/h1-15,28-30H

Standard InChI Key:  QMHOADREOBOGDA-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 33 37  0  0  0  0  0  0  0  0999 V2000
   18.5400  -23.7949    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.3651  -23.7990    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   18.9562  -23.0824    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.3637  -21.3195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3626  -22.1470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0774  -22.5600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0756  -20.9067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7911  -21.3159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7919  -22.1428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5072  -22.5538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2224  -22.1390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2177  -21.3089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5017  -20.9016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0732  -20.0816    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.6490  -20.9071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6522  -20.0811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9385  -19.6688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2230  -20.0816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9402  -21.3194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2278  -20.9107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5197  -21.3234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5228  -22.1445    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2400  -22.5514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9452  -22.1364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0793  -23.3851    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.3676  -24.6244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6506  -25.0344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6521  -25.8587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3682  -26.2705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0842  -25.8518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0791  -25.0288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3712  -27.0956    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   19.3677  -19.6700    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  2  0
  5  6  1  0
  6  9  2  0
  8  7  2  0
  7  4  1  0
  8  9  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13  8  1  0
  7 14  1  0
  4 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 20  1  0
 19 15  1  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 19  2  0
  6 25  1  0
 25  2  1  0
  2 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 26  1  0
 29 32  1  0
 16 33  1  0
M  END

Associated Targets(Human)

ENTPD5 Tbio Ectonucleoside triphosphate diphosphohydrolase 5 (478 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

pyrH Uridylate kinase (158 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 459.50Molecular Weight (Monoisotopic): 459.0941AlogP: 6.01#Rotatable Bonds: 4
Polar Surface Area: 86.63Molecular Species: NEUTRALHBA: 4HBD: 3
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 7.75CX Basic pKa: CX LogP: 5.62CX LogD: 5.46
Aromatic Rings: 5Heavy Atoms: 33QED Weighted: 0.29Np Likeness Score: -0.56

References

1.  (2012)  Entpd5 inhibitors, 

Source