(1S,4s)-4-hydroxy-4-(2-methyl-4-((R)-1-(3-(trifluoromethyl)phenyl)ethylamino)quinazolin-6-yl)cyclohexyl acetate

ID: ALA4540165

PubChem CID: 135177143

Max Phase: Preclinical

Molecular Formula: C26H28F3N3O3

Molecular Weight: 487.52

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(=O)O[C@H]1CC[C@](O)(c2ccc3nc(C)nc(N[C@H](C)c4cccc(C(F)(F)F)c4)c3c2)CC1

Standard InChI:  InChI=1S/C26H28F3N3O3/c1-15(18-5-4-6-20(13-18)26(27,28)29)30-24-22-14-19(7-8-23(22)31-16(2)32-24)25(34)11-9-21(10-12-25)35-17(3)33/h4-8,13-15,21,34H,9-12H2,1-3H3,(H,30,31,32)/t15-,21-,25+/m1/s1

Standard InChI Key:  HUYHXYPWGPJHPM-RFHMVHFQSA-N

Molfile:  

 
     RDKit          2D

 35 38  0  0  0  0  0  0  0  0999 V2000
   11.4943   -7.4084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5623   -3.7494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2708   -4.1602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2696   -4.9797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9777   -5.3887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6873   -4.9793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6845   -4.1566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9759   -3.7513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9775   -6.2059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2697   -6.6143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6851   -6.6147    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.6849   -7.4319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9766   -7.8360    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.9761   -8.6524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6842   -9.0620    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.2681   -9.0605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3914   -7.8341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3910   -8.6489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0953   -9.0548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8004   -8.6471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7969   -7.8293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0921   -7.4270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2075   -7.8041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9028   -7.3867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8912   -6.5718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1781   -6.1761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4766   -6.5953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5925   -6.1522    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.5638   -2.9322    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    5.8538   -4.1567    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    5.8483   -3.3389    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   11.4902   -8.2256    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.3065   -6.5497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0077   -6.1301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3193   -7.3668    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  3  1  0
  5  9  1  0
  9 10  1  6
  9 11  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 18  1  0
 17 12  1  0
 14 16  1  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 17  2  0
  1 21  1  0
  3  2  1  0
  1 23  1  0
  1 27  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 25 28  1  6
  2 29  1  0
  2 30  1  0
  2 31  1  0
  1 32  1  6
 28 33  1  0
 33 34  1  0
 33 35  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4540165

    ---

Associated Targets(Human)

SOS1 Tchem Son of sevenless homolog 1 (1023 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 487.52Molecular Weight (Monoisotopic): 487.2083AlogP: 5.82#Rotatable Bonds: 5
Polar Surface Area: 84.34Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.98CX Basic pKa: 5.76CX LogP: 4.95CX LogD: 4.94
Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.44Np Likeness Score: -0.50

References

1.  (2018)  Novel benzylamino substituted quinazolines and derivatives as sos1 inhibitors, 

Source