The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(1S,4s)-4-hydroxy-4-(2-methyl-4-((R)-1-(3-(trifluoromethyl)phenyl)ethylamino)quinazolin-6-yl)cyclohexyl acetate ID: ALA4540165
PubChem CID: 135177143
Max Phase: Preclinical
Molecular Formula: C26H28F3N3O3
Molecular Weight: 487.52
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)O[C@H]1CC[C@](O)(c2ccc3nc(C)nc(N[C@H](C)c4cccc(C(F)(F)F)c4)c3c2)CC1
Standard InChI: InChI=1S/C26H28F3N3O3/c1-15(18-5-4-6-20(13-18)26(27,28)29)30-24-22-14-19(7-8-23(22)31-16(2)32-24)25(34)11-9-21(10-12-25)35-17(3)33/h4-8,13-15,21,34H,9-12H2,1-3H3,(H,30,31,32)/t15-,21-,25+/m1/s1
Standard InChI Key: HUYHXYPWGPJHPM-RFHMVHFQSA-N
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
11.4943 -7.4084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5623 -3.7494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2708 -4.1602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2696 -4.9797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9777 -5.3887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6873 -4.9793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6845 -4.1566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9759 -3.7513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9775 -6.2059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2697 -6.6143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6851 -6.6147 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.6849 -7.4319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9766 -7.8360 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.9761 -8.6524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6842 -9.0620 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.2681 -9.0605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3914 -7.8341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3910 -8.6489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0953 -9.0548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8004 -8.6471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7969 -7.8293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0921 -7.4270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2075 -7.8041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9028 -7.3867 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8912 -6.5718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1781 -6.1761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4766 -6.5953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5925 -6.1522 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.5638 -2.9322 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5.8538 -4.1567 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5.8483 -3.3389 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
11.4902 -8.2256 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.3065 -6.5497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0077 -6.1301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3193 -7.3668 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3 4 2 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 3 1 0
5 9 1 0
9 10 1 6
9 11 1 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 18 1 0
17 12 1 0
14 16 1 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 17 2 0
1 21 1 0
3 2 1 0
1 23 1 0
1 27 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
25 28 1 6
2 29 1 0
2 30 1 0
2 31 1 0
1 32 1 6
28 33 1 0
33 34 1 0
33 35 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 487.52Molecular Weight (Monoisotopic): 487.2083AlogP: 5.82#Rotatable Bonds: 5Polar Surface Area: 84.34Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.98CX Basic pKa: 5.76CX LogP: 4.95CX LogD: 4.94Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.44Np Likeness Score: -0.50
References 1. (2018) Novel benzylamino substituted quinazolines and derivatives as sos1 inhibitors,