4-bromo-N-(2-(3,4-dichlorophenyl)-3-(4-(methylthio)phenyl)-1-(naphthalen-1-yl)-3-oxopropyl)benzamide

ID: ALA4540169

PubChem CID: 155549776

Max Phase: Preclinical

Molecular Formula: C33H24BrCl2NO2S

Molecular Weight: 649.44

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CSc1ccc(C(=O)C(c2ccc(Cl)c(Cl)c2)C(NC(=O)c2ccc(Br)cc2)c2cccc3ccccc23)cc1

Standard InChI:  InChI=1S/C33H24BrCl2NO2S/c1-40-25-16-11-21(12-17-25)32(38)30(23-13-18-28(35)29(36)19-23)31(37-33(39)22-9-14-24(34)15-10-22)27-8-4-6-20-5-2-3-7-26(20)27/h2-19,30-31H,1H3,(H,37,39)

Standard InChI Key:  FLLHUZZKHWFXGH-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 40 44  0  0  0  0  0  0  0  0999 V2000
   17.7730  -26.1728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7704  -26.9978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4866  -27.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2012  -27.0022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2038  -26.1773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4918  -25.7626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9132  -27.4170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6277  -27.0068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3439  -27.4215    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.6304  -26.1818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9184  -25.7671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9210  -24.9422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6356  -24.5320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3518  -24.9467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3491  -25.7717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0611  -25.7581    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   18.4945  -24.9377    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   20.6382  -23.7071    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   19.9262  -23.2923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9097  -28.4877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1952  -28.8979    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.1925  -29.7228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4780  -30.1330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9045  -30.1375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.4753  -30.9579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7566  -31.3682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0446  -30.9535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0472  -30.1286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7618  -29.7183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7271  -29.0242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7233  -29.8585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4430  -30.2771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1669  -29.8625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4463  -28.6100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1637  -29.0247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.8794  -28.6107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.8789  -27.7823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1567  -27.3696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4440  -27.7858    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3215  -31.3676    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  4  7  1  0
  7  8  1  0
  8  9  2  0
  8 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 10  1  0
  1 16  1  0
  6 17  1  0
 13 18  1  0
 18 19  1  0
  7 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 22 24  2  0
 23 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 23  1  0
 20 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 35  1  0
 34 30  1  0
 34 35  1  0
 35 36  2  0
 36 37  1  0
 37 38  2  0
 38 39  1  0
 39 34  2  0
 27 40  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4540169

    ---

Associated Targets(non-human)

Vero (26788 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Leishmania donovani (89745 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 649.44Molecular Weight (Monoisotopic): 647.0088AlogP: 9.77#Rotatable Bonds: 8
Polar Surface Area: 46.17Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: 2HBA (Lipinski): 3HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: 11.63CX Basic pKa: CX LogP: 9.57CX LogD: 9.57
Aromatic Rings: 5Heavy Atoms: 40QED Weighted: 0.13Np Likeness Score: -0.94

References

1. Chandrakar P, Gunaganti N, Parmar N, Kumar A, Singh SK, Rashid M, Wahajuddin M, Mitra K, Narender T, Kar S..  (2019)  β-Amino acid derivatives as mitochondrial complex III inhibitors of L. donovani: A promising chemotype targeting visceral leishmaniasis.,  182  [PMID:31499363] [10.1016/j.ejmech.2019.111632]

Source