4-(2-phenoxy-2-phenylethoxy)-1-m-tolylpyridin-2(1H)-one

ID: ALA4540170

PubChem CID: 155549777

Max Phase: Preclinical

Molecular Formula: C26H23NO3

Molecular Weight: 397.47

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1cccc(-n2ccc(OCC(Oc3ccccc3)c3ccccc3)cc2=O)c1

Standard InChI:  InChI=1S/C26H23NO3/c1-20-9-8-12-22(17-20)27-16-15-24(18-26(27)28)29-19-25(21-10-4-2-5-11-21)30-23-13-6-3-7-14-23/h2-18,25H,19H2,1H3

Standard InChI Key:  LNKBYGIBGUXVRV-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
   10.6964  -11.3622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6952  -12.1818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4033  -12.5907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1129  -12.1813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1101  -11.3586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4015  -10.9534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8163  -10.9474    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.5255  -11.3533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2317  -10.9420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9409  -11.3480    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.6471  -10.9367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3523  -11.3435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0563  -10.9357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0575  -10.1182    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.3484   -9.7101    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6381  -10.1195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3481   -8.8929    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.7652   -9.7096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4696  -10.1213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1768   -9.7134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1773   -8.8954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4646   -8.4869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7603   -8.8972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5286  -12.1705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4617   -7.6697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8233  -12.5786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8260  -13.3950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5358  -13.8018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2443  -13.3861    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2381  -12.5710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  5  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 11 16  2  0
 12 13  2  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 15 17  2  0
 14 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
  8 24  1  0
 22 25  1  0
 24 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 24  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4540170

    ---

Associated Targets(non-human)

Grm3 Metabotropic glutamate receptor 3 (981 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 397.47Molecular Weight (Monoisotopic): 397.1678AlogP: 5.35#Rotatable Bonds: 7
Polar Surface Area: 40.46Molecular Species: NEUTRALHBA: 4HBD:
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 5.55CX LogD: 5.55
Aromatic Rings: 4Heavy Atoms: 30QED Weighted: 0.42Np Likeness Score: -0.82

References

1. Yamada Y, Yohn SE, Gilliland K, Loch MT, Schulte ML, Rodriguez AL, Blobaum AL, Niswender CM, Conn PJ, Lindsley CW..  (2019)  Further exploration of an N-aryl phenoxyethoxy pyridinone-based series of mGlu3 NAMs: Challenging SAR, enantiospecific activity and in vivo efficacy.,  29  (18): [PMID:31358468] [10.1016/j.bmcl.2019.07.030]

Source