The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-1-(4-(3-(diethylamino)propoxy)-2-hydroxyphenyl)-3-(4-(3-(diethylamino)propoxy)phenyl)prop-2-en-1-one ID: ALA4540199
PubChem CID: 155550156
Max Phase: Preclinical
Molecular Formula: C29H42N2O4
Molecular Weight: 482.67
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCN(CC)CCCOc1ccc(/C=C/C(=O)c2ccc(OCCCN(CC)CC)cc2O)cc1
Standard InChI: InChI=1S/C29H42N2O4/c1-5-30(6-2)19-9-21-34-25-14-11-24(12-15-25)13-18-28(32)27-17-16-26(23-29(27)33)35-22-10-20-31(7-3)8-4/h11-18,23,33H,5-10,19-22H2,1-4H3/b18-13+
Standard InChI Key: QIAWRNCGELMICX-QGOAFFKASA-N
Molfile:
RDKit 2D
35 36 0 0 0 0 0 0 0 0999 V2000
28.5549 -24.1608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5537 -24.9803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2618 -25.3893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9714 -24.9798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9686 -24.1572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2600 -23.7519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6748 -23.7459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3840 -24.1518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0902 -23.7406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7994 -24.1465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0871 -22.9234 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.7994 -24.9626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5078 -25.3684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2150 -24.9571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2092 -24.1357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5003 -23.7335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.4935 -22.9164 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.8457 -25.3883 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.1383 -24.9792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4303 -25.3872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9247 -25.3621 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.6304 -24.9499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.3401 -25.3549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7229 -24.9781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0149 -25.3861 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.0458 -24.9427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7555 -25.3476 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.3075 -24.9769 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5995 -25.3850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0142 -26.2033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3062 -26.6113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.4612 -24.9354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.1709 -25.3404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7597 -26.1648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.4695 -26.5698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
5 7 1 0
7 8 2 0
8 9 1 0
9 10 1 0
9 11 2 0
10 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 10 1 0
16 17 1 0
2 18 1 0
18 19 1 0
19 20 1 0
14 21 1 0
21 22 1 0
22 23 1 0
20 24 1 0
24 25 1 0
23 26 1 0
26 27 1 0
25 28 1 0
28 29 1 0
25 30 1 0
30 31 1 0
27 32 1 0
32 33 1 0
27 34 1 0
34 35 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 482.67Molecular Weight (Monoisotopic): 482.3145AlogP: 5.51#Rotatable Bonds: 17Polar Surface Area: 62.24Molecular Species: BASEHBA: 6HBD: 1#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 7.09CX Basic pKa: 9.88CX LogP: 3.86CX LogD: 2.40Aromatic Rings: 2Heavy Atoms: 35QED Weighted: 0.18Np Likeness Score: -0.25
References 1. Bai P, Wang K, Zhang P, Shi J, Cheng X, Zhang Q, Zheng C, Cheng Y, Yang J, Lu X, Sang Z.. (2019) Development of chalcone-O-alkylamine derivatives as multifunctional agents against Alzheimer's disease., 183 [PMID:31581002 ] [10.1016/j.ejmech.2019.111737 ]