The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
((1R,4r)-4-(4-((R)-1-(3-amino-5-(trifluoromethyl)phenyl)ethylamino)-2-methylquinazolin-6-yl)cyclohexyl)(morpholino)methanone ID: ALA4540213
PubChem CID: 155550190
Max Phase: Preclinical
Molecular Formula: C29H34F3N5O2
Molecular Weight: 541.62
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1nc(N[C@H](C)c2cc(N)cc(C(F)(F)F)c2)c2cc([C@H]3CC[C@H](C(=O)N4CCOCC4)CC3)ccc2n1
Standard InChI: InChI=1S/C29H34F3N5O2/c1-17(22-13-23(29(30,31)32)16-24(33)14-22)34-27-25-15-21(7-8-26(25)35-18(2)36-27)19-3-5-20(6-4-19)28(38)37-9-11-39-12-10-37/h7-8,13-17,19-20H,3-6,9-12,33H2,1-2H3,(H,34,35,36)/t17-,19-,20-/m1/s1
Standard InChI Key: YJWXSDFOGANZBM-MISYRCLQSA-N
Molfile:
RDKit 2D
39 43 0 0 0 0 0 0 0 0999 V2000
7.7922 -2.7589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9313 -6.4620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9307 -8.1004 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.2184 -7.6908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3467 -6.4571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5089 -3.1738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9337 -3.9970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2182 -2.7649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0551 -7.6855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3500 -8.0932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2198 -5.2319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0516 -6.8635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5063 -8.0989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5078 -3.9975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9309 -3.1702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2200 -4.4106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2189 -6.8702 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.6420 -6.8683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9315 -5.6406 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.6416 -7.6872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5078 -5.6403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7583 -6.4532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7932 -1.9417 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
7.0840 -3.1666 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
7.0782 -2.3484 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
13.4641 -6.8619 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1687 -6.4551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1709 -5.6375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4623 -5.2285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7516 -5.6370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8791 -5.2299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5863 -5.6394 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.8802 -4.4127 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.6366 -2.7581 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.5812 -6.4558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2843 -6.8652 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9949 -6.4611 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.9980 -5.6429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2904 -5.2289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18 20 1 0
8 6 1 0
7 15 1 0
19 2 1 0
20 10 2 0
15 8 2 0
14 16 1 0
4 3 2 0
16 7 2 0
9 12 2 0
12 5 1 0
16 11 1 0
18 2 1 0
2 17 2 0
11 19 1 0
11 21 1 6
6 1 1 0
6 14 2 0
3 20 1 0
4 13 1 0
5 18 2 0
10 9 1 0
17 4 1 0
22 12 1 6
1 23 1 0
1 24 1 0
1 25 1 0
22 26 1 0
22 30 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
28 31 1 1
31 32 1 0
31 33 2 0
15 34 1 0
32 35 1 0
32 39 1 0
35 36 1 0
36 37 1 0
37 38 1 0
38 39 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 541.62Molecular Weight (Monoisotopic): 541.2665AlogP: 5.84#Rotatable Bonds: 5Polar Surface Area: 93.37Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 5.89CX LogP: 5.03CX LogD: 5.01Aromatic Rings: 3Heavy Atoms: 39QED Weighted: 0.39Np Likeness Score: -1.40
References 1. (2018) Novel benzylamino substituted quinazolines and derivatives as sos1 inhibitors,