7alpha-hydroxy alisol A

ID: ALA4540228

PubChem CID: 155550231

Max Phase: Preclinical

Molecular Formula: C30H50O6

Molecular Weight: 506.72

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C[C@H](C[C@H](O)[C@@H](O)C(C)(C)O)C1=C2C[C@H](O)[C@H]3[C@@]4(C)CCC(=O)C(C)(C)[C@@H]4C[C@@H](O)[C@]3(C)[C@@]2(C)CC1

Standard InChI:  InChI=1S/C30H50O6/c1-16(13-20(32)25(35)27(4,5)36)17-9-12-29(7)18(17)14-19(31)24-28(6)11-10-22(33)26(2,3)21(28)15-23(34)30(24,29)8/h16,19-21,23-25,31-32,34-36H,9-15H2,1-8H3/t16-,19+,20+,21+,23-,24+,25-,28+,29+,30+/m1/s1

Standard InChI Key:  SDRBSSYOASHUNN-VAEVJGACSA-N

Molfile:  

 
     RDKit          2D

 38 41  0  0  0  0  0  0  0  0999 V2000
   31.2060  -14.4990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8015  -13.7891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3884  -14.4964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.0916  -12.5592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.0916  -13.3805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8052  -12.1464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5104  -12.5592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5070  -13.3805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2090  -13.7939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.9273  -13.3865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2160  -12.1513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.9269  -12.5676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.9437  -10.9288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2212  -11.3327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.6505  -11.3492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.6371  -12.1671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4110  -12.4313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2089  -12.9719    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   31.5031  -11.7378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.9188  -11.7461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4990  -14.1977    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   29.3845  -13.7942    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.6328  -12.9801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4326  -11.1106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.9030  -11.7754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5213  -10.9178    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.7012  -10.3291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.5113  -10.1715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.0528  -10.7912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.1555   -9.7093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.7843  -11.5727    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.8630  -10.6336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.4045  -11.2575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.2146  -11.0958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.1400  -12.0390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.9870  -11.8369    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.1315   -9.8522    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.6419  -13.8015    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  5  1  0
  4  6  1  0
  5  2  1  0
  2  8  1  0
  7  6  1  0
  7  8  1  0
  7 11  1  0
  8  9  1  0
  9 10  1  0
 10 12  1  0
 11 12  1  0
 11 14  1  0
 12 16  1  0
 15 13  1  0
 13 14  1  0
 15 16  1  0
 16 17  1  0
 17 25  1  0
 24 15  2  0
 11 18  1  1
  7 19  1  1
 12 20  1  6
  8 21  1  6
  5 22  2  0
 16 23  1  1
 24 25  1  0
 14 26  1  1
 24 27  1  0
 27 28  1  0
 28 29  1  0
 27 30  1  6
 29 31  1  1
 29 32  1  0
 32 33  1  0
 33 34  1  0
 33 35  1  0
 33 36  1  0
 32 37  1  1
 10 38  1  6
M  END

Alternative Forms

  1. Parent:

    ALA4540228

    ---

Associated Targets(Human)

NR1H4 Tclin Bile acid receptor FXR (6228 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 506.72Molecular Weight (Monoisotopic): 506.3607AlogP: 3.77#Rotatable Bonds: 5
Polar Surface Area: 118.22Molecular Species: NEUTRALHBA: 6HBD: 5
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 5#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.01CX Basic pKa: CX LogP: 2.52CX LogD: 2.52
Aromatic Rings: Heavy Atoms: 36QED Weighted: 0.36Np Likeness Score: 3.19

References

1. Luan ZL, Huo XK, Dong PP, Tian XG, Sun CP, Lv X, Feng L, Ning J, Wang C, Zhang BJ, Ma XC..  (2019)  Highly potent non-steroidal FXR agonists protostane-type triterpenoids: Structure-activity relationship and mechanism.,  182  [PMID:31494470] [10.1016/j.ejmech.2019.111652]

Source