4-Amino-N-(2-chloro-6-methylphenyl)-4'-fluoro-[1,1'-biphenyl]-3-carboxamide

ID: ALA4540260

PubChem CID: 155549703

Max Phase: Preclinical

Molecular Formula: C20H16ClFN2O

Molecular Weight: 354.81

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1cccc(Cl)c1NC(=O)c1cc(-c2ccc(F)cc2)ccc1N

Standard InChI:  InChI=1S/C20H16ClFN2O/c1-12-3-2-4-17(21)19(12)24-20(25)16-11-14(7-10-18(16)23)13-5-8-15(22)9-6-13/h2-11H,23H2,1H3,(H,24,25)

Standard InChI Key:  QXRSKXLQPUZRLD-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 25 27  0  0  0  0  0  0  0  0999 V2000
    5.3516   -3.0706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3505   -3.8902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0585   -4.2991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7682   -3.8897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7653   -3.0670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0567   -2.6618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6459   -2.6624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6470   -1.8441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9400   -1.4357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2314   -1.8445    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2343   -2.6660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9418   -3.0706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5231   -1.4371    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    7.4765   -4.2972    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.4715   -2.6558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1807   -3.0617    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.4684   -1.8386    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.8869   -2.6504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5946   -3.0598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3002   -2.6492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2976   -1.8311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5834   -1.4254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8806   -1.8383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5956   -3.8769    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    8.1698   -1.4351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
  1  7  1  0
 10 13  1  0
  4 14  1  0
  5 15  1  0
 15 16  1  0
 15 17  2  0
 16 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
 19 24  1  0
 23 25  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4540260

    ---

Associated Targets(Human)

CHRNA7 Tchem Neuronal acetylcholine receptor protein alpha-7 subunit (3524 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 354.81Molecular Weight (Monoisotopic): 354.0935AlogP: 5.29#Rotatable Bonds: 3
Polar Surface Area: 55.12Molecular Species: NEUTRALHBA: 2HBD: 2
#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 1.95CX LogP: 5.79CX LogD: 5.79
Aromatic Rings: 3Heavy Atoms: 25QED Weighted: 0.63Np Likeness Score: -1.44

References

1. Li X, Xie W, Wang X, Huang Z, Bian X, Wang K, Sun Q..  (2019)  Chemical conversion of nicotinamide into type I positive allosteric modulator of α7 nAChRs.,  29  (15): [PMID:31153804] [10.1016/j.bmcl.2019.05.046]

Source