The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2R)-2-((1,4-Dioxo-1,4-dihydronaphthalen-2-yl)amino)-3-phenyl-N-(m-tolyl)propanamide ID: ALA4540285
PubChem CID: 141744829
Max Phase: Preclinical
Molecular Formula: C26H22N2O3
Molecular Weight: 410.47
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cccc(NC(=O)[C@@H](Cc2ccccc2)NC2=CC(=O)c3ccccc3C2=O)c1
Standard InChI: InChI=1S/C26H22N2O3/c1-17-8-7-11-19(14-17)27-26(31)23(15-18-9-3-2-4-10-18)28-22-16-24(29)20-12-5-6-13-21(20)25(22)30/h2-14,16,23,28H,15H2,1H3,(H,27,31)/t23-/m1/s1
Standard InChI Key: UGOPOWWFKPDZBW-HSZRJFAPSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
2.5492 -18.1556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5481 -18.9752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2561 -19.3841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2543 -17.7468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9629 -18.1520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9618 -18.9772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6719 -19.3886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3877 -18.9793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3889 -18.1541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6742 -17.7382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6743 -16.9210 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.0976 -17.7472 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.8043 -18.1576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5130 -17.7507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8023 -18.9747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5090 -19.3851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5027 -20.1997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2086 -20.6100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9182 -20.2030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9176 -19.3816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2112 -18.9751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2197 -18.1610 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.5150 -16.9335 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.9284 -17.7542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6315 -18.1670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3397 -17.7608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3422 -16.9427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6305 -16.5325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9252 -16.9411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6695 -20.2058 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.6296 -15.7154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 10 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
9 12 1 0
13 12 1 1
13 14 1 0
13 15 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
14 22 1 0
14 23 2 0
22 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
7 30 2 0
28 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 410.47Molecular Weight (Monoisotopic): 410.1630AlogP: 4.10#Rotatable Bonds: 6Polar Surface Area: 75.27Molecular Species: NEUTRALHBA: 4HBD: 2#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.30CX Basic pKa: ┄CX LogP: 4.42CX LogD: 4.42Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.64Np Likeness Score: -0.37
References 1. Huang R, Jing X, Huang X, Pan Y, Fang Y, Liang G, Liao Z, Wang H, Chen Z, Zhang Y.. (2020) Bifunctional Naphthoquinone Aromatic Amide-Oxime Derivatives Exert Combined Immunotherapeutic and Antitumor Effects through Simultaneous Targeting of Indoleamine-2,3-dioxygenase and Signal Transducer and Activator of Transcription 3., 63 (4): [PMID:31999451 ] [10.1021/acs.jmedchem.9b01386 ]