The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(2-(4-Methylpiperazin-1-yl)-4-methoxy-5-((4-(4-trifluoromethylbenzamido)pyrimidin-2-yl)-amino)phenyl)acrylamide ID: ALA4540295
PubChem CID: 155549934
Max Phase: Preclinical
Molecular Formula: C27H28F3N7O3
Molecular Weight: 555.56
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: C=CC(=O)Nc1cc(Nc2nccc(NC(=O)c3ccc(C(F)(F)F)cc3)n2)c(OC)cc1N1CCN(C)CC1
Standard InChI: InChI=1S/C27H28F3N7O3/c1-4-24(38)32-19-15-20(22(40-3)16-21(19)37-13-11-36(2)12-14-37)33-26-31-10-9-23(35-26)34-25(39)17-5-7-18(8-6-17)27(28,29)30/h4-10,15-16H,1,11-14H2,2-3H3,(H,32,38)(H2,31,33,34,35,39)
Standard InChI Key: XKWRCIFNOMMIOC-UHFFFAOYSA-N
Molfile:
RDKit 2D
40 43 0 0 0 0 0 0 0 0999 V2000
33.5147 -21.2898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5135 -22.1172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2284 -22.5301 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.9449 -22.1167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9420 -21.2861 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.2266 -20.8769 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2242 -20.0518 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.5083 -19.6414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5059 -18.8164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7950 -20.0561 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.6601 -22.5281 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.3741 -22.1145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.0859 -22.5263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7993 -22.1134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7984 -21.2874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.0782 -20.8761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.3677 -21.2915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.0860 -23.3514 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.3714 -23.7641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.0740 -20.0511 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.3574 -19.6422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.3532 -18.8171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.6449 -20.0584 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.0656 -18.4009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2211 -18.4065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2190 -17.5821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5027 -17.1709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7870 -17.5900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7927 -18.4129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.5117 -20.8728 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.4994 -16.3478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.4962 -15.5970 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
34.1655 -15.8001 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
32.8287 -15.8059 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
39.2218 -21.2866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.9330 -20.8755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.9348 -20.0501 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.2193 -19.6374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.5018 -20.0502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.6498 -19.6382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
6 7 1 0
7 8 1 0
8 9 1 0
8 10 2 0
4 11 1 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
13 18 1 0
18 19 1 0
16 20 1 0
20 21 1 0
21 22 1 0
21 23 2 0
22 24 2 0
9 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 9 1 0
15 30 1 0
31 32 1 0
31 33 1 0
31 34 1 0
27 31 1 0
30 35 1 0
30 39 1 0
35 36 1 0
36 37 1 0
37 38 1 0
38 39 1 0
37 40 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 555.56Molecular Weight (Monoisotopic): 555.2206AlogP: 4.38#Rotatable Bonds: 8Polar Surface Area: 111.72Molecular Species: NEUTRALHBA: 8HBD: 3#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.15CX Basic pKa: 7.56CX LogP: 4.52CX LogD: 4.13Aromatic Rings: 3Heavy Atoms: 40QED Weighted: 0.35Np Likeness Score: -1.42
References 1. Chen L, Chi F, Wang T, Wang N, Li W, Liu K, Shu X, Ma X, Xu Y.. (2018) The synthesis of 4-arylamido-2-arylaminoprimidines as potent EGFR T790M/L858R inhibitors for NSCLC., 26 (23-24): [PMID:30471829 ] [10.1016/j.bmc.2018.11.009 ]