The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(3-fluoro-4-((6-methoxy-7-((1-methylpiperidin-4-yl)methoxy)quinazolin-4-yl)amino)phenyl)benzamide ID: ALA4540305
PubChem CID: 146180759
Max Phase: Preclinical
Molecular Formula: C29H30FN5O3
Molecular Weight: 515.59
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc2c(Nc3ccc(NC(=O)c4ccccc4)cc3F)ncnc2cc1OCC1CCN(C)CC1
Standard InChI: InChI=1S/C29H30FN5O3/c1-35-12-10-19(11-13-35)17-38-27-16-25-22(15-26(27)37-2)28(32-18-31-25)34-24-9-8-21(14-23(24)30)33-29(36)20-6-4-3-5-7-20/h3-9,14-16,18-19H,10-13,17H2,1-2H3,(H,33,36)(H,31,32,34)
Standard InChI Key: WQGIOCDYUFZQAY-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 42 0 0 0 0 0 0 0 0999 V2000
5.9275 -4.9415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9264 -5.7688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6412 -6.1817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6393 -4.5287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3548 -4.9379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3555 -5.7647 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0709 -6.1756 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.7858 -5.7609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7811 -4.9309 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.0652 -4.5237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2117 -6.1807 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.2130 -4.5291 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.2128 -3.7041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4975 -5.7677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7827 -6.1796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0714 -5.7613 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3588 -6.1696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3538 -6.9950 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.0678 -7.4102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7866 -7.0001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6376 -7.4042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0608 -3.6987 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.7731 -3.2825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4851 -3.6946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1968 -3.2790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1929 -2.4531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4713 -2.0447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7625 -2.4625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0435 -2.0580 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
10.9046 -2.0359 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.8991 -1.2110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6109 -0.7938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1820 -0.8033 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.3299 -1.2043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0411 -0.7877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0362 0.0381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3140 0.4456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6057 0.0268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
2 11 1 0
1 12 1 0
12 13 1 0
11 14 1 0
14 15 1 0
15 16 1 0
15 20 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
18 21 1 0
10 22 1 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
28 29 1 0
26 30 1 0
30 31 1 0
31 32 1 0
31 33 2 0
32 34 2 0
34 35 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 515.59Molecular Weight (Monoisotopic): 515.2333AlogP: 5.49#Rotatable Bonds: 8Polar Surface Area: 88.61Molecular Species: BASEHBA: 7HBD: 2#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 9.13CX LogP: 4.87CX LogD: 3.14Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.32Np Likeness Score: -1.44
References 1. Li Q, Zhang T, Li S, Tong L, Li J, Su Z, Feng F, Sun D, Tong Y, Wang X, Zhao Z, Zhu L, Ding J, Li H, Xie H, Xu Y.. (2019) Discovery of Potent and Noncovalent Reversible EGFR Kinase Inhibitors of EGFRL858R/T790M/C797S ., 10 (6): [PMID:31223440 ] [10.1021/acsmedchemlett.8b00564 ]