The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N1-[4-[2-(Difluoromethyl)-4-methoxy-1H-benzimidazol-1-yl]-6-(4-morpholinyl)-1,3,5-triazin-2-yl]-N3-N3-dimethyl-N1-[1-(methylsulfonyl)-3-piperidinyl]-1,3-propanediamine ID: ALA4540331
PubChem CID: 46917725
Max Phase: Preclinical
Molecular Formula: C27H39F2N9O4S
Molecular Weight: 623.73
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cccc2c1nc(C(F)F)n2-c1nc(N2CCOCC2)nc(N(CCCN(C)C)C2CCCN(S(C)(=O)=O)C2)n1
Standard InChI: InChI=1S/C27H39F2N9O4S/c1-34(2)11-7-13-37(19-8-6-12-36(18-19)43(4,39)40)26-31-25(35-14-16-42-17-15-35)32-27(33-26)38-20-9-5-10-21(41-3)22(20)30-24(38)23(28)29/h5,9-10,19,23H,6-8,11-18H2,1-4H3
Standard InChI Key: FBSSQDSKJUFWBE-UHFFFAOYSA-N
Molfile:
RDKit 2D
43 47 0 0 0 0 0 0 0 0999 V2000
41.3837 -26.5133 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.9793 -25.8076 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
40.5703 -26.5107 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.0334 -24.5776 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.0323 -25.3971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.7403 -25.8061 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.4500 -25.3967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.4471 -24.5740 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.7385 -24.1687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3242 -25.8052 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.6205 -25.3916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9146 -25.7961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9098 -26.6137 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.6170 -27.0250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3291 -26.6188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.7361 -23.3516 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.3890 -22.8685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.1351 -22.0919 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.0678 -22.8723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.3176 -22.0975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.7721 -21.4957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9766 -21.6675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7295 -22.4465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2767 -23.0449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.0856 -23.2959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.0637 -24.1128 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
38.8040 -22.9064 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
36.0220 -20.7177 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.8208 -20.5451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.1583 -25.8042 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.1596 -26.6213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.8654 -25.3945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.5682 -25.8053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.2731 -25.3991 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
40.2761 -24.5815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.5679 -24.1719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.8567 -24.5797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.8680 -27.0288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.6885 -25.4022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.8692 -27.8460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.5776 -28.2535 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.5789 -29.0707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.2846 -27.8438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
5 10 1 0
10 11 1 0
10 15 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
9 16 1 0
16 17 1 0
17 18 2 0
18 20 1 0
19 16 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
17 25 1 0
25 26 1 0
25 27 1 0
21 28 1 0
28 29 1 0
7 30 1 0
30 31 1 0
30 32 1 0
32 33 1 0
32 37 1 0
33 34 1 0
34 35 1 0
35 36 1 0
36 37 1 0
31 38 1 0
34 2 1 0
2 39 1 0
38 40 1 0
40 41 1 0
41 42 1 0
41 43 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 623.73Molecular Weight (Monoisotopic): 623.2814AlogP: 2.18#Rotatable Bonds: 11Polar Surface Area: 122.05Molecular Species: BASEHBA: 12HBD: ┄#RO5 Violations: 2HBA (Lipinski): 13HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 9.40CX LogP: 2.72CX LogD: 0.72Aromatic Rings: 3Heavy Atoms: 43QED Weighted: 0.31Np Likeness Score: -1.47
References 1. Giddens AC, Gamage SA, Kendall JD, Lee WJ, Baguley BC, Buchanan CM, Jamieson SMF, Dickson JMJ, Shepherd PR, Denny WA, Rewcastle GW.. (2019) Synthesis and biological evaluation of solubilized sulfonamide analogues of the phosphatidylinositol 3-kinase inhibitor ZSTK474., 27 (8): [PMID:30850264 ] [10.1016/j.bmc.2019.02.050 ]