The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(2-butyl-4-chloro-1H-imidazol-5-yl)-6-methyl-N-(4-nitrophenyl)-2-oxo-1,2,3,4-tetrahydro-pyrimidine-5-carboxamide ID: ALA4540344
PubChem CID: 145999183
Max Phase: Preclinical
Molecular Formula: C19H21ClN6O4
Molecular Weight: 432.87
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCCCc1nc(Cl)c(C2NC(=O)NC(C)=C2C(=O)Nc2ccc([N+](=O)[O-])cc2)[nH]1
Standard InChI: InChI=1S/C19H21ClN6O4/c1-3-4-5-13-23-16(17(20)24-13)15-14(10(2)21-19(28)25-15)18(27)22-11-6-8-12(9-7-11)26(29)30/h6-9,15H,3-5H2,1-2H3,(H,22,27)(H,23,24)(H2,21,25,28)
Standard InChI Key: KFINSLQGWIDIKF-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 32 0 0 0 0 0 0 0 0999 V2000
9.3345 -9.3453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7772 -8.9566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7568 -9.3365 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.5831 -5.4319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4419 -6.8438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6176 -8.9432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4770 -10.5682 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.1995 -8.9519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9202 -6.1803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7698 -8.1353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0506 -10.5770 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.4792 -7.7202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7202 -4.0118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6995 -7.6228 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.4900 -9.3628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0440 -8.9344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6298 -7.7288 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
9.6206 -6.8471 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.6284 -10.5858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0366 -8.1131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3378 -10.1666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7601 -10.1578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9123 -9.3541 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.0572 -4.7643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6143 -8.1219 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.3689 -7.6307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1920 -8.1306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0551 -7.7322 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.3504 -8.1460 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.0491 -6.9150 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8 27 2 0
5 18 2 0
6 23 1 0
21 19 1 0
10 12 2 0
22 11 1 0
16 20 1 0
22 7 2 0
15 2 2 0
9 4 1 0
26 17 1 0
24 13 1 0
2 10 1 0
21 11 1 0
18 26 1 0
1 21 2 0
23 8 1 0
5 9 1 0
1 6 1 0
6 25 2 0
3 16 1 0
22 3 1 0
20 14 1 0
16 1 1 0
12 27 1 0
8 15 1 0
5 14 1 0
26 20 2 0
4 24 1 0
28 29 2 0
28 30 1 0
10 28 1 0
M CHG 2 28 1 30 -1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 432.87Molecular Weight (Monoisotopic): 432.1313AlogP: 3.58#Rotatable Bonds: 7Polar Surface Area: 142.05Molecular Species: NEUTRALHBA: 5HBD: 4#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.67CX Basic pKa: 4.36CX LogP: 2.22CX LogD: 2.22Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.39Np Likeness Score: -1.54
References 1. Desai NC, Trivedi AR, Khedkar VM.. (2016) Preparation, biological evaluation and molecular docking study of imidazolyl dihydropyrimidines as potential Mycobacterium tuberculosis dihydrofolate reductase inhibitors., 26 (16): [PMID:27397497 ] [10.1016/j.bmcl.2016.06.082 ]