4-(2-butyl-4-chloro-1H-imidazol-5-yl)-6-methyl-N-(4-nitrophenyl)-2-oxo-1,2,3,4-tetrahydro-pyrimidine-5-carboxamide

ID: ALA4540344

PubChem CID: 145999183

Max Phase: Preclinical

Molecular Formula: C19H21ClN6O4

Molecular Weight: 432.87

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCCCc1nc(Cl)c(C2NC(=O)NC(C)=C2C(=O)Nc2ccc([N+](=O)[O-])cc2)[nH]1

Standard InChI:  InChI=1S/C19H21ClN6O4/c1-3-4-5-13-23-16(17(20)24-13)15-14(10(2)21-19(28)25-15)18(27)22-11-6-8-12(9-7-11)26(29)30/h6-9,15H,3-5H2,1-2H3,(H,22,27)(H,23,24)(H2,21,25,28)

Standard InChI Key:  KFINSLQGWIDIKF-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 30 32  0  0  0  0  0  0  0  0999 V2000
    9.3345   -9.3453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7772   -8.9566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7568   -9.3365    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.5831   -5.4319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4419   -6.8438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6176   -8.9432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4770  -10.5682    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.1995   -8.9519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9202   -6.1803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7698   -8.1353    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0506  -10.5770    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.4792   -7.7202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7202   -4.0118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6995   -7.6228    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.4900   -9.3628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0440   -8.9344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6298   -7.7288    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    9.6206   -6.8471    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.6284  -10.5858    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0366   -8.1131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3378  -10.1666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7601  -10.1578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9123   -9.3541    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.0572   -4.7643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6143   -8.1219    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.3689   -7.6307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1920   -8.1306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0551   -7.7322    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.3504   -8.1460    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0491   -6.9150    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  8 27  2  0
  5 18  2  0
  6 23  1  0
 21 19  1  0
 10 12  2  0
 22 11  1  0
 16 20  1  0
 22  7  2  0
 15  2  2  0
  9  4  1  0
 26 17  1  0
 24 13  1  0
  2 10  1  0
 21 11  1  0
 18 26  1  0
  1 21  2  0
 23  8  1  0
  5  9  1  0
  1  6  1  0
  6 25  2  0
  3 16  1  0
 22  3  1  0
 20 14  1  0
 16  1  1  0
 12 27  1  0
  8 15  1  0
  5 14  1  0
 26 20  2  0
  4 24  1  0
 28 29  2  0
 28 30  1  0
 10 28  1  0
M  CHG  2  28   1  30  -1
M  END

Alternative Forms

  1. Parent:

    ALA4540344

    ---

Associated Targets(non-human)

Vero (26788 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Mycobacterium tuberculosis (203094 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 432.87Molecular Weight (Monoisotopic): 432.1313AlogP: 3.58#Rotatable Bonds: 7
Polar Surface Area: 142.05Molecular Species: NEUTRALHBA: 5HBD: 4
#RO5 Violations: HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: 10.67CX Basic pKa: 4.36CX LogP: 2.22CX LogD: 2.22
Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.39Np Likeness Score: -1.54

References

1. Desai NC, Trivedi AR, Khedkar VM..  (2016)  Preparation, biological evaluation and molecular docking study of imidazolyl dihydropyrimidines as potential Mycobacterium tuberculosis dihydrofolate reductase inhibitors.,  26  (16): [PMID:27397497] [10.1016/j.bmcl.2016.06.082]

Source