The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
[18F]-4-(5-(1-((4-fluoro-3,5-dimethylpyridin-2-yl)methyl)-1H-1,2,3-triazol-4-yl)-3-phenylisoxazol-4-yl)benzenesulfonamide ID: ALA4540374
PubChem CID: 58758110
Max Phase: Preclinical
Molecular Formula: C25H21FN6O3S
Molecular Weight: 504.55
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cnc(Cn2cc(-c3onc(-c4ccccc4)c3-c3ccc(S(N)(=O)=O)cc3)nn2)c(C)c1[18F]
Standard InChI: InChI=1S/C25H21FN6O3S/c1-15-12-28-20(16(2)23(15)26)13-32-14-21(29-31-32)25-22(17-8-10-19(11-9-17)36(27,33)34)24(30-35-25)18-6-4-3-5-7-18/h3-12,14H,13H2,1-2H3,(H2,27,33,34)/i26-1
Standard InChI Key: SHJNUGUJSPNKHU-KPVNRNJOSA-N
Molfile:
RDKit 2D
36 40 0 0 0 0 0 0 0 0999 V2000
11.3334 -8.3535 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.6276 -8.7662 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
11.3379 -9.1711 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.8954 -6.1248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7125 -6.1248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9669 -5.3481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3040 -4.8660 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.6452 -5.3481 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.7441 -5.0970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4045 -5.5783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0663 -5.0988 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.8148 -4.3212 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.9977 -4.3202 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.8432 -5.3524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4512 -4.8065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2262 -5.0617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8339 -4.5165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6653 -3.7160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8836 -3.4636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2793 -4.0104 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.2726 -3.1692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3937 -5.8615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6106 -4.7705 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
9.1921 -6.7865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8558 -7.5310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3346 -8.1922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1483 -8.1081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4809 -7.3570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0000 -6.6989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2965 -9.5158 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.4142 -6.7853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6011 -6.6944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1201 -7.3541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4515 -8.1020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2686 -8.1863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7460 -7.5257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 1 0
8 4 2 0
9 10 2 0
10 11 1 0
11 12 1 0
12 13 2 0
13 9 1 0
6 9 1 0
11 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
18 21 1 0
16 22 1 0
17 23 1 0
5 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
27 2 1 0
2 30 1 0
4 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 31 1 0
M ISO 1 23 18
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 504.55Molecular Weight (Monoisotopic): 504.1380AlogP: 4.11#Rotatable Bonds: 6Polar Surface Area: 129.79Molecular Species: NEUTRALHBA: 8HBD: 1#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 10.01CX Basic pKa: 5.16CX LogP: 4.38CX LogD: 4.38Aromatic Rings: 5Heavy Atoms: 36QED Weighted: 0.37Np Likeness Score: -1.53
References 1. Bosc D, Camberlein V, Gealageas R, Castillo-Aguilera O, Deprez B, Deprez-Poulain R.. (2020) Kinetic Target-Guided Synthesis: Reaching the Age of Maturity., 63 (8): [PMID:31820982 ] [10.1021/acs.jmedchem.9b01183 ]