The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-3-(4-((4-((5-Chloro-4-((4-fluorophenyl)amino)pyrimidin-2-yl)-amino)-1H-pyrazol-1-yl)methyl)phenyl)-N-hydroxyacrylamide ID: ALA4540416
PubChem CID: 155550122
Max Phase: Preclinical
Molecular Formula: C23H19ClFN7O2
Molecular Weight: 479.90
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C(/C=C/c1ccc(Cn2cc(Nc3ncc(Cl)c(Nc4ccc(F)cc4)n3)cn2)cc1)NO
Standard InChI: InChI=1S/C23H19ClFN7O2/c24-20-12-26-23(30-22(20)28-18-8-6-17(25)7-9-18)29-19-11-27-32(14-19)13-16-3-1-15(2-4-16)5-10-21(33)31-34/h1-12,14,34H,13H2,(H,31,33)(H2,26,28,29,30)/b10-5+
Standard InChI Key: JXCWYACGTXCGDU-BJMVGYQFSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
5.1131 -30.3865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8256 -30.7981 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.5327 -30.3843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2418 -30.7963 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.9525 -30.3832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9517 -29.5610 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.2342 -29.1537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5265 -29.5650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6648 -30.7951 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.3762 -30.3816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1226 -30.7189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6687 -30.1069 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.2593 -29.3954 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.4561 -29.5663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4861 -30.1040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1141 -29.5659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4025 -29.1585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6903 -29.5683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6942 -30.3938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4064 -30.8017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9773 -29.1617 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5.8161 -29.1611 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
11.8963 -29.3907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7180 -29.3922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1240 -28.6798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7128 -27.9684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8873 -27.9739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4808 -28.6869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1180 -27.2546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9393 -27.2506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3486 -26.5409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1699 -26.5370 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.5750 -25.8232 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.9324 -25.8311 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 3 1 0
5 9 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 1 0
13 14 2 0
14 10 1 0
12 15 1 0
1 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 1 1 0
18 21 1 0
8 22 1 0
15 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
26 29 1 0
29 30 2 0
30 31 1 0
31 32 1 0
32 33 1 0
31 34 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 479.90Molecular Weight (Monoisotopic): 479.1273AlogP: 4.52#Rotatable Bonds: 8Polar Surface Area: 116.99Molecular Species: NEUTRALHBA: 8HBD: 4#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.53CX Basic pKa: 2.00CX LogP: 4.45CX LogD: 4.45Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.17Np Likeness Score: -1.58
References 1. Liang X, Zang J, Li X, Tang S, Huang M, Geng M, Chou CJ, Li C, Cao Y, Xu W, Liu H, Zhang Y.. (2019) Discovery of Novel Janus Kinase (JAK) and Histone Deacetylase (HDAC) Dual Inhibitors for the Treatment of Hematological Malignancies., 62 (8): [PMID:30901208 ] [10.1021/acs.jmedchem.8b01597 ]