The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-N-(3,4-dimethoxybenzyl)-1-(2-((1-(1-methylpiperidin-4-yl)-1H-pyrazol-4-yl)amino)pyridin-4-yl)piperidine-3-carboxamide ID: ALA4540437
PubChem CID: 155550196
Max Phase: Preclinical
Molecular Formula: C29H39N7O3
Molecular Weight: 533.68
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(CNC(=O)[C@H]2CCCN(c3ccnc(Nc4cnn(C5CCN(C)CC5)c4)c3)C2)cc1OC
Standard InChI: InChI=1S/C29H39N7O3/c1-34-13-9-24(10-14-34)36-20-23(18-32-36)33-28-16-25(8-11-30-28)35-12-4-5-22(19-35)29(37)31-17-21-6-7-26(38-2)27(15-21)39-3/h6-8,11,15-16,18,20,22,24H,4-5,9-10,12-14,17,19H2,1-3H3,(H,30,33)(H,31,37)/t22-/m0/s1
Standard InChI Key: OHGVDAHVBZQSEY-QFIPXVFZSA-N
Molfile:
RDKit 2D
39 43 0 0 0 0 0 0 0 0999 V2000
5.9927 -12.2950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9927 -13.1163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7021 -13.5249 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.4115 -13.1163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4115 -12.2950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7021 -11.8823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7017 -14.3454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9882 -14.7534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9879 -15.5740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7003 -15.9875 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.4144 -15.5704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4113 -14.7512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1246 -11.8885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8352 -12.2992 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.1270 -11.0672 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.5482 -11.8926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2589 -12.3033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2551 -13.1256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9608 -13.5404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6748 -13.1297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6746 -12.3041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9642 -11.8972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2759 -15.9863 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.5676 -15.5787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4786 -14.7696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6791 -14.6008 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.2714 -15.3091 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8191 -15.9155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3457 -13.8547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8298 -13.1946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4997 -12.4510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6870 -12.3625 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.2054 -13.0238 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5365 -13.7738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3564 -11.6151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3815 -11.8942 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.0900 -12.3015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3823 -13.5387 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.3817 -14.3559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 6 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
3 7 1 0
5 13 1 6
13 14 1 0
13 15 2 0
14 16 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
9 23 1 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 1 0
27 28 2 0
28 24 1 0
26 29 1 0
29 30 1 0
29 34 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
32 35 1 0
21 36 1 0
36 37 1 0
20 38 1 0
38 39 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 533.68Molecular Weight (Monoisotopic): 533.3114AlogP: 3.84#Rotatable Bonds: 9Polar Surface Area: 96.78Molecular Species: BASEHBA: 9HBD: 2#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 9.08CX LogP: 2.41CX LogD: -0.16Aromatic Rings: 3Heavy Atoms: 39QED Weighted: 0.43Np Likeness Score: -1.43
References 1. Liu S, Jiang Y, Yan R, Li Z, Wan S, Zhang T, Wu X, Hou J, Zhu Z, Tian Y, Zhang J.. (2019) Design, synthesis and biological evaluations of 2-amino-4-(1-piperidine) pyridine derivatives as novel anti crizotinib-resistant ALK/ROS1 dual inhibitors., 179 [PMID:31260890 ] [10.1016/j.ejmech.2019.06.043 ]