3-amino-N-[(2S)-2-(2,5-difluoro-4-piperazin-1-yl-phenyl)propyl]-5-fluoro-6-methyl-thieno[2,3-b]pyridine-2-carboxamide

ID: ALA4540452

PubChem CID: 153311082

Max Phase: Preclinical

Molecular Formula: C22H24F3N5OS

Molecular Weight: 463.53

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1nc2sc(C(=O)NC[C@@H](C)c3cc(F)c(N4CCNCC4)cc3F)c(N)c2cc1F

Standard InChI:  InChI=1S/C22H24F3N5OS/c1-11(13-7-17(25)18(9-16(13)24)30-5-3-27-4-6-30)10-28-21(31)20-19(26)14-8-15(23)12(2)29-22(14)32-20/h7-9,11,27H,3-6,10,26H2,1-2H3,(H,28,31)/t11-/m1/s1

Standard InChI Key:  WUSFNASFKWPOOP-LLVKDONJSA-N

Molfile:  

 
     RDKit          2D

 32 35  0  0  0  0  0  0  0  0999 V2000
    1.7774  -10.6565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7763  -11.4760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4843  -11.8850    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.4825  -10.2476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1911  -10.6529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1964  -11.4761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9808  -11.7255    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    4.4592  -11.0564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9723  -10.3936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2197   -9.6151    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.2764  -11.0553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6895  -11.7578    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.6804  -10.3434    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.5067  -11.7525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9199  -12.4591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7370  -12.4539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1440  -13.1628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9602  -13.1579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3653  -12.4495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9468  -11.7401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1322  -11.7492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1824  -12.4430    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.0682  -11.8840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5930  -13.1462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4067  -13.1416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8134  -12.4324    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.4003  -11.7262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5805  -11.7292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0696  -10.2480    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    6.5155  -13.1693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7153  -11.0463    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    9.3724  -13.8636    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9  5  1  0
  9 10  1  0
  8 11  1  0
 11 12  1  0
 11 13  2  0
 12 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
 19 22  1  0
  2 23  1  0
 22 24  1  0
 22 28  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
  1 29  1  0
 15 30  1  6
 21 31  1  0
 18 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4540452

    ---

Associated Targets(Human)

USP28 Tchem Ubiquitin carboxyl-terminal hydrolase 28 (268 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
USP25 Tchem Ubiquitin carboxyl-terminal hydrolase 25 (268 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 463.53Molecular Weight (Monoisotopic): 463.1654AlogP: 3.55#Rotatable Bonds: 5
Polar Surface Area: 83.28Molecular Species: BASEHBA: 6HBD: 3
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 8.78CX LogP: 3.54CX LogD: 2.14
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.54Np Likeness Score: -1.54

References

1.  (2017)  Thienopyridine carboxamides as ubiquitin-specific protease inhibitors, 

Source