The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3R,5-dihydroxy-2,2,8,8-tetramethyl-6-(2-methylpropanoyl)-2,3-dihydro-4H,8H-pyrano[2,3-f]chromen-4-one ID: ALA4540475
PubChem CID: 155549715
Max Phase: Preclinical
Molecular Formula: C20H24O6
Molecular Weight: 360.41
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)C(=O)c1c(O)c2c(c3c1OC(C)(C)C=C3)OC(C)(C)[C@@H](O)C2=O
Standard InChI: InChI=1S/C20H24O6/c1-9(2)13(21)11-14(22)12-15(23)18(24)20(5,6)26-17(12)10-7-8-19(3,4)25-16(10)11/h7-9,18,22,24H,1-6H3/t18-/m0/s1
Standard InChI Key: YJKFINKKXCMYDY-SFHVURJKSA-N
Molfile:
RDKit 2D
26 28 0 0 0 0 0 0 0 0999 V2000
26.4844 -7.5941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9066 -8.1760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6995 -8.3855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5730 -9.4060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3902 -9.4060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9816 -8.6982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3902 -10.2231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0955 -10.6276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0955 -8.9932 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.8008 -9.4060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7992 -10.2213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5034 -10.6286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2097 -10.2217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5027 -11.4458 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.5025 -8.9996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2109 -9.4030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9106 -8.9935 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.1997 -7.7754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4938 -8.1866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9169 -10.6311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9159 -11.4483 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.6251 -10.2234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3323 -10.6328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6261 -9.4062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6831 -10.6328 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.0967 -11.4448 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
5 4 1 0
6 5 1 0
5 7 1 0
5 9 1 0
7 8 1 0
8 11 1 0
10 9 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 16 1 0
15 10 1 0
12 14 1 0
15 16 2 0
15 19 1 0
16 17 1 0
17 2 1 0
2 18 1 0
18 19 2 0
13 20 1 0
20 21 2 0
20 22 1 0
22 23 1 0
22 24 1 0
7 25 1 6
8 26 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 360.41Molecular Weight (Monoisotopic): 360.1573AlogP: 3.13#Rotatable Bonds: 2Polar Surface Area: 93.06Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.54CX Basic pKa: ┄CX LogP: 3.99CX LogD: 3.96Aromatic Rings: 1Heavy Atoms: 26QED Weighted: 0.79Np Likeness Score: 2.85
References 1. Fobofou SA, Franke K, Porzel A, Brandt W, Wessjohann LA.. (2016) Tricyclic Acylphloroglucinols from Hypericum lanceolatum and Regioselective Synthesis of Selancins A and B., 79 (4): [PMID:26950610 ] [10.1021/acs.jnatprod.5b00673 ]