5-(4-(4-Carboxyphenyl)-1H-1,2,3-triazol-1-yl)-4'-(piperidin-4-yl)-[1,1'-biphenyl]-3-carboxylic Acid

ID: ALA4540545

PubChem CID: 135356961

Max Phase: Preclinical

Molecular Formula: C27H24N4O4

Molecular Weight: 468.51

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(O)c1ccc(-c2cn(-c3cc(C(=O)O)cc(-c4ccc(C5CCNCC5)cc4)c3)nn2)cc1

Standard InChI:  InChI=1S/C27H24N4O4/c32-26(33)21-7-5-20(6-8-21)25-16-31(30-29-25)24-14-22(13-23(15-24)27(34)35)18-3-1-17(2-4-18)19-9-11-28-12-10-19/h1-8,13-16,19,28H,9-12H2,(H,32,33)(H,34,35)

Standard InChI Key:  IZMPSBRMCWSUFH-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 35 39  0  0  0  0  0  0  0  0999 V2000
   26.0840   -2.7337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8994   -2.7348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3064   -2.0303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8990   -1.3242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0804   -1.3270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6772   -2.0321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1198   -2.0280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5276   -2.7374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.3440   -2.7380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.7536   -2.0298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.3408   -1.3197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5257   -1.3226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5691   -2.0268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9772   -2.7359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.7908   -2.7370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2025   -2.0306    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.7943   -1.3215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9745   -1.3188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6692   -0.6209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0751    0.0932    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.8520   -0.6239    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.6762   -3.4452    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.8635   -3.5309    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.6938   -4.3302    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.4016   -4.7387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0087   -4.1917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4857   -5.5487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8231   -6.0288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9083   -6.8408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6556   -7.1737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.3185   -6.6885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2299   -5.8783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7424   -7.9863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.0820   -8.4677    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.4895   -8.3174    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
  3  7  1  0
 13 14  1  0
 13 18  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 10 13  1  0
  5 19  1  0
 19 20  1  0
 19 21  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 22  1  0
  1 22  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 27  1  0
 25 27  1  0
 30 33  1  0
 33 34  1  0
 33 35  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4540545

    ---

Associated Targets(Human)

P2RY14 Tchem Purinergic receptor P2Y14 (692 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 468.51Molecular Weight (Monoisotopic): 468.1798AlogP: 4.46#Rotatable Bonds: 6
Polar Surface Area: 117.34Molecular Species: ZWITTERIONHBA: 6HBD: 3
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 3.55CX Basic pKa: 10.07CX LogP: 2.02CX LogD: -0.76
Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.38Np Likeness Score: -0.82

References

1. Junker A, Balasubramanian R, Ciancetta A, Uliassi E, Kiselev E, Martiriggiano C, Trujillo K, Mtchedlidze G, Birdwell L, Brown KA, Harden TK, Jacobson KA..  (2016)  Structure-Based Design of 3-(4-Aryl-1H-1,2,3-triazol-1-yl)-Biphenyl Derivatives as P2Y14 Receptor Antagonists.,  59  (13): [PMID:27331270] [10.1021/acs.jmedchem.6b00044]

Source