The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N,N-Dimethyl-1-propyl-5-((4-(trifluoromethyl)phenethyl)amino)-4,5,6,7-tetrahydro-1H-indazole-3-carboxamide ID: ALA4540551
PubChem CID: 146597639
Max Phase: Preclinical
Molecular Formula: C22H29F3N4O
Molecular Weight: 422.50
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCCn1nc(C(=O)N(C)C)c2c1CCC(NCCc1ccc(C(F)(F)F)cc1)C2
Standard InChI: InChI=1S/C22H29F3N4O/c1-4-13-29-19-10-9-17(14-18(19)20(27-29)21(30)28(2)3)26-12-11-15-5-7-16(8-6-15)22(23,24)25/h5-8,17,26H,4,9-14H2,1-3H3
Standard InChI Key: UAJVTCVZRHYCPX-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 32 0 0 0 0 0 0 0 0999 V2000
18.3538 -25.3907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3538 -26.2120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0632 -26.6206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0632 -24.9780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5476 -26.4575 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.0284 -25.7990 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.5453 -25.1381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7685 -25.3907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7699 -26.2078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8005 -24.3563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6036 -24.1849 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.2538 -23.7489 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.8555 -23.4075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1509 -24.7918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8006 -27.2345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2541 -27.8421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5071 -28.6192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6454 -24.9833 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.9384 -25.3931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2300 -24.9856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5230 -25.3954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8157 -24.9850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1092 -25.3941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1101 -26.2121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8235 -26.6194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5271 -26.2079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4036 -26.6228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6947 -26.2163 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
13.4061 -27.4400 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
12.6912 -27.0251 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 4 1 0
2 3 1 0
3 9 1 0
8 4 1 0
8 9 2 0
6 7 2 0
5 6 1 0
7 8 1 0
9 5 1 0
7 10 1 0
10 11 1 0
10 12 2 0
11 13 1 0
11 14 1 0
5 15 1 0
15 16 1 0
16 17 1 0
1 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
24 27 1 0
27 28 1 0
27 29 1 0
27 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 422.50Molecular Weight (Monoisotopic): 422.2293AlogP: 3.70#Rotatable Bonds: 7Polar Surface Area: 50.16Molecular Species: BASEHBA: 4HBD: 1#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 9.81CX LogP: 4.01CX LogD: 1.66Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.74Np Likeness Score: -1.74
References 1. Iyamu ID, Lv W, Malik N, Mishra RK, Schiltz GE.. (2019) Discovery of a novel class of potent and selective tetrahydroindazole-based sigma-1 receptor ligands., 27 (9): [PMID:30904383 ] [10.1016/j.bmc.2019.03.030 ]