N,N-Dimethyl-1-propyl-5-((4-(trifluoromethyl)phenethyl)amino)-4,5,6,7-tetrahydro-1H-indazole-3-carboxamide

ID: ALA4540551

PubChem CID: 146597639

Max Phase: Preclinical

Molecular Formula: C22H29F3N4O

Molecular Weight: 422.50

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCCn1nc(C(=O)N(C)C)c2c1CCC(NCCc1ccc(C(F)(F)F)cc1)C2

Standard InChI:  InChI=1S/C22H29F3N4O/c1-4-13-29-19-10-9-17(14-18(19)20(27-29)21(30)28(2)3)26-12-11-15-5-7-16(8-6-15)22(23,24)25/h5-8,17,26H,4,9-14H2,1-3H3

Standard InChI Key:  UAJVTCVZRHYCPX-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 30 32  0  0  0  0  0  0  0  0999 V2000
   18.3538  -25.3907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3538  -26.2120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0632  -26.6206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0632  -24.9780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5476  -26.4575    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.0284  -25.7990    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.5453  -25.1381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7685  -25.3907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7699  -26.2078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8005  -24.3563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6036  -24.1849    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.2538  -23.7489    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.8555  -23.4075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1509  -24.7918    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8006  -27.2345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2541  -27.8421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5071  -28.6192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6454  -24.9833    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.9384  -25.3931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2300  -24.9856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5230  -25.3954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8157  -24.9850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1092  -25.3941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1101  -26.2121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8235  -26.6194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5271  -26.2079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4036  -26.6228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6947  -26.2163    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   13.4061  -27.4400    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   12.6912  -27.0251    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  4  1  0
  2  3  1  0
  3  9  1  0
  8  4  1  0
  8  9  2  0
  6  7  2  0
  5  6  1  0
  7  8  1  0
  9  5  1  0
  7 10  1  0
 10 11  1  0
 10 12  2  0
 11 13  1  0
 11 14  1  0
  5 15  1  0
 15 16  1  0
 16 17  1  0
  1 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
 24 27  1  0
 27 28  1  0
 27 29  1  0
 27 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4540551

    ---

Associated Targets(Human)

SIGMAR1 Tclin Sigma opioid receptor (6358 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
TMEM97 Tchem Sigma intracellular receptor 2 (973 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 422.50Molecular Weight (Monoisotopic): 422.2293AlogP: 3.70#Rotatable Bonds: 7
Polar Surface Area: 50.16Molecular Species: BASEHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 9.81CX LogP: 4.01CX LogD: 1.66
Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.74Np Likeness Score: -1.74

References

1. Iyamu ID, Lv W, Malik N, Mishra RK, Schiltz GE..  (2019)  Discovery of a novel class of potent and selective tetrahydroindazole-based sigma-1 receptor ligands.,  27  (9): [PMID:30904383] [10.1016/j.bmc.2019.03.030]

Source