The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-((2-Chloro-6-fluorobenzyl)oxy)-1-((3-(trifluoromethyl)phenyl)sulfonyl)indoline ID: ALA4540555
PubChem CID: 155549587
Max Phase: Preclinical
Molecular Formula: C22H16ClF4NO3S
Molecular Weight: 485.89
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=S(=O)(c1cccc(C(F)(F)F)c1)N1CCc2ccc(OCc3c(F)cccc3Cl)cc21
Standard InChI: InChI=1S/C22H16ClF4NO3S/c23-19-5-2-6-20(24)18(19)13-31-16-8-7-14-9-10-28(21(14)12-16)32(29,30)17-4-1-3-15(11-17)22(25,26)27/h1-8,11-12H,9-10,13H2
Standard InChI Key: CHMUJIGPMFODBS-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
8.1411 -3.2498 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.9411 -3.4665 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
8.7288 -2.6654 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.9150 -3.2914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9139 -4.1187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6286 -4.5316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3451 -4.1182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3422 -3.2878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6269 -2.8787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0550 -2.8726 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
3.6284 -5.3566 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
5.0602 -4.5296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7739 -4.1160 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.4890 -4.5274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4856 -5.3507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1998 -5.7620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1959 -4.1117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9107 -4.5192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9177 -5.3455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7058 -5.5941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1858 -4.9215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6943 -4.2572 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.7479 -3.2921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3015 -3.9044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1062 -3.7265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3551 -2.9390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7930 -2.3294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9903 -2.5105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6632 -4.3351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4145 -5.1217 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
12.4686 -4.1571 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
12.2450 -4.9163 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
8 10 1 0
6 11 1 0
7 12 1 0
12 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 19 2 0
18 17 2 0
17 14 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 18 1 0
22 2 1 0
2 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
25 29 1 0
29 30 1 0
29 31 1 0
29 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 485.89Molecular Weight (Monoisotopic): 485.0476AlogP: 5.83#Rotatable Bonds: 5Polar Surface Area: 46.61Molecular Species: NEUTRALHBA: 3HBD: ┄#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 5.92CX LogD: 5.92Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.43Np Likeness Score: -1.98
References 1. Zhu Y, Sun N, Yu M, Guo H, Xie Q, Wang Y.. (2019) Discovery of aryl-substituted indole and indoline derivatives as RORγt agonists., 182 [PMID:31425906 ] [10.1016/j.ejmech.2019.111589 ]