6-((2-Chloro-6-fluorobenzyl)oxy)-1-((3-(trifluoromethyl)phenyl)sulfonyl)indoline

ID: ALA4540555

PubChem CID: 155549587

Max Phase: Preclinical

Molecular Formula: C22H16ClF4NO3S

Molecular Weight: 485.89

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=S(=O)(c1cccc(C(F)(F)F)c1)N1CCc2ccc(OCc3c(F)cccc3Cl)cc21

Standard InChI:  InChI=1S/C22H16ClF4NO3S/c23-19-5-2-6-20(24)18(19)13-31-16-8-7-14-9-10-28(21(14)12-16)32(29,30)17-4-1-3-15(11-17)22(25,26)27/h1-8,11-12H,9-10,13H2

Standard InChI Key:  CHMUJIGPMFODBS-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 35  0  0  0  0  0  0  0  0999 V2000
    8.1411   -3.2498    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.9411   -3.4665    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    8.7288   -2.6654    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.9150   -3.2914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9139   -4.1187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6286   -4.5316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3451   -4.1182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3422   -3.2878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6269   -2.8787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0550   -2.8726    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    3.6284   -5.3566    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    5.0602   -4.5296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7739   -4.1160    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.4890   -4.5274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4856   -5.3507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1998   -5.7620    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1959   -4.1117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9107   -4.5192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9177   -5.3455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7058   -5.5941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1858   -4.9215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6943   -4.2572    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.7479   -3.2921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3015   -3.9044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1062   -3.7265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3551   -2.9390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7930   -2.3294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9903   -2.5105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6632   -4.3351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4145   -5.1217    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   12.4686   -4.1571    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   12.2450   -4.9163    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
  8 10  1  0
  6 11  1  0
  7 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 19  2  0
 18 17  2  0
 17 14  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 18  1  0
 22  2  1  0
  2 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
 25 29  1  0
 29 30  1  0
 29 31  1  0
 29 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4540555

    ---

Associated Targets(Human)

RORC Tchem Nuclear receptor ROR-gamma (8495 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 485.89Molecular Weight (Monoisotopic): 485.0476AlogP: 5.83#Rotatable Bonds: 5
Polar Surface Area: 46.61Molecular Species: NEUTRALHBA: 3HBD:
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 5.92CX LogD: 5.92
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.43Np Likeness Score: -1.98

References

1. Zhu Y, Sun N, Yu M, Guo H, Xie Q, Wang Y..  (2019)  Discovery of aryl-substituted indole and indoline derivatives as RORγt agonists.,  182  [PMID:31425906] [10.1016/j.ejmech.2019.111589]

Source