4-[(4-oxo-2-phenyl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-6(4H)-yl)carbonyl]benzenesulfonamide

ID: ALA4540574

PubChem CID: 155549634

Max Phase: Preclinical

Molecular Formula: C20H18N4O4S

Molecular Weight: 410.46

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  NS(=O)(=O)c1ccc(C(=O)N2CCc3nc(-c4ccccc4)[nH]c(=O)c3C2)cc1

Standard InChI:  InChI=1S/C20H18N4O4S/c21-29(27,28)15-8-6-14(7-9-15)20(26)24-11-10-17-16(12-24)19(25)23-18(22-17)13-4-2-1-3-5-13/h1-9H,10-12H2,(H2,21,27,28)(H,22,23,25)

Standard InChI Key:  FLKMCUCHEIMTPR-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 29 32  0  0  0  0  0  0  0  0999 V2000
   44.9992   -4.4863    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   44.5947   -3.7805    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   44.1857   -4.4837    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.1201   -3.7805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.1189   -4.6000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.8270   -5.0090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.5366   -4.5996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.5338   -3.7769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.8252   -3.3716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.2400   -3.3656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.9466   -3.7738    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   38.9427   -2.1404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.2324   -2.5498    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   38.9424   -1.3232    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   39.6518   -2.5485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.6502   -3.3680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.3553   -3.7768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.0663   -3.3706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.0678   -2.5511    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   40.3583   -2.1378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.7767   -2.1446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.4832   -2.5552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.7790   -1.3274    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   42.4765   -3.3730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.1822   -3.7835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.1855   -2.1486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.8918   -2.5555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.8884   -3.3735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.3038   -3.3746    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
  8 10  1  0
 10 11  2  0
 10 13  1  0
 11 16  1  0
 15 12  1  0
 12 13  1  0
 12 14  2  0
 15 16  2  0
 15 20  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 19 21  1  0
 21 22  1  0
 21 23  2  0
 22 24  2  0
 24 25  1  0
 25 28  2  0
 27 26  2  0
 26 22  1  0
 27 28  1  0
 28  2  1  0
  2 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4540574

    ---

Associated Targets(Human)

MTHFD2 Tchem Bifunctional methylenetetrahydrofolate dehydrogenase/cyclohydrolase, mitochondrial (78 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 410.46Molecular Weight (Monoisotopic): 410.1049AlogP: 1.28#Rotatable Bonds: 3
Polar Surface Area: 126.22Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 7.98CX Basic pKa: 0.40CX LogP: 0.59CX LogD: 0.50
Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.67Np Likeness Score: -1.63

References

1. Kawai J, Ota M, Ohki H, Toki T, Suzuki M, Shimada T, Matsui S, Inoue H, Sugihara C, Matsuhashi N, Matsui Y, Takaishi S, Nakayama K..  (2019)  Structure-Based Design and Synthesis of an Isozyme-Selective MTHFD2 Inhibitor with a Tricyclic Coumarin Scaffold.,  10  (6): [PMID:31223444] [10.1021/acsmedchemlett.9b00069]

Source