4-[3-(2,6-dichlorobenzoyl)indazol-1-yl]benzoic acid

ID: ALA4540580

PubChem CID: 118142071

Max Phase: Preclinical

Molecular Formula: C21H12Cl2N2O3

Molecular Weight: 411.24

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(O)c1ccc(-n2nc(C(=O)c3c(Cl)cccc3Cl)c3ccccc32)cc1

Standard InChI:  InChI=1S/C21H12Cl2N2O3/c22-15-5-3-6-16(23)18(15)20(26)19-14-4-1-2-7-17(14)25(24-19)13-10-8-12(9-11-13)21(27)28/h1-11H,(H,27,28)

Standard InChI Key:  GVWQZVAMODQAFX-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 28 31  0  0  0  0  0  0  0  0999 V2000
    9.0661   -5.3035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0650   -6.1230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7730   -6.5320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7712   -4.8946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4798   -5.2999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4846   -6.1185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2647   -6.3669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7420   -5.7018    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.2569   -5.0424    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.5049   -4.2637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3050   -4.0939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5531   -3.3161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0024   -2.7111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2006   -2.8891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9562   -3.6667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2494   -1.9321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0475   -1.7564    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.6982   -1.3287    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.5217   -7.1426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9784   -7.7531    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.3220   -7.3079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5738   -8.0836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3733   -8.2491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9175   -7.6383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6566   -6.8594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8577   -6.6976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5966   -5.9233    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   12.0285   -8.6923    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9  5  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 10  1  0
 13 16  1  0
 16 17  1  0
 16 18  2  0
  7 19  1  0
 19 20  2  0
 19 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
 26 27  1  0
 22 28  1  0
M  END

Alternative Forms

Associated Targets(Human)

RORC Tchem Nuclear receptor ROR-gamma (8495 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Rorc Nuclear receptor ROR-gamma (89407 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 411.24Molecular Weight (Monoisotopic): 410.0225AlogP: 5.26#Rotatable Bonds: 4
Polar Surface Area: 72.19Molecular Species: ACIDHBA: 4HBD: 1
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 4.53CX Basic pKa: CX LogP: 5.79CX LogD: 3.00
Aromatic Rings: 4Heavy Atoms: 28QED Weighted: 0.47Np Likeness Score: -0.96

References

1. Shaikh NS, Iyer JP, Munot YS, Mukhopadhyay PP, Raje AA, Nagaraj R, Jamdar V, Gavhane R, Lohote M, Sherkar P, Bala M, Petla R, Meru A, Umrani D, Rouduri S, Joshi S, Reddy S, Kandikere V, Bhuniya D, Kulkarni B, Mookhtiar KA..  (2019)  Discovery and pharmacological evaluation of indole derivatives as potent and selective RORγt inverse agonist for multiple autoimmune conditions.,  29  (16): [PMID:31272795] [10.1016/j.bmcl.2019.06.044]

Source