N-(2-(1H-indol-3-yl)ethyl)-5-hydroxy-2-methyl-4-oxo-4H-pyran-3-carboxamide

ID: ALA4540636

PubChem CID: 130407876

Max Phase: Preclinical

Molecular Formula: C17H16N2O4

Molecular Weight: 312.32

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1occ(O)c(=O)c1C(=O)NCCc1c[nH]c2ccccc12

Standard InChI:  InChI=1S/C17H16N2O4/c1-10-15(16(21)14(20)9-23-10)17(22)18-7-6-11-8-19-13-5-3-2-4-12(11)13/h2-5,8-9,19-20H,6-7H2,1H3,(H,18,22)

Standard InChI Key:  CLPZQPMYBVCJBG-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 23 25  0  0  0  0  0  0  0  0999 V2000
    6.8271  -25.3035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8271  -26.1326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5388  -26.5451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2547  -26.1326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2547  -25.3035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5388  -24.8910    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.1113  -26.5451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1113  -27.3701    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.3997  -26.1326    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.6838  -26.5451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5388  -27.3701    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.1113  -24.8910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9705  -26.5451    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.9697  -26.1320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2550  -26.5439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3562  -27.5373    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.1632  -27.3663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9443  -26.8224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4993  -26.2125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2483  -25.4288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4426  -25.2540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8884  -25.8690    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1424  -26.6502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  1  6  1  0
  7  8  2  0
  7  9  1  0
  2  7  1  0
  9 10  1  0
  3 11  2  0
  1 12  1  0
  4 13  1  0
 10 14  1  0
 14 15  1  0
 15 19  1  0
 18 16  1  0
 16 17  1  0
 17 15  2  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4540636

    ---

Associated Targets(non-human)

PA Polymerase acidic protein (806 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 312.32Molecular Weight (Monoisotopic): 312.1110AlogP: 2.11#Rotatable Bonds: 4
Polar Surface Area: 95.33Molecular Species: NEUTRALHBA: 4HBD: 3
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 9.01CX Basic pKa: CX LogP: 1.66CX LogD: 1.65
Aromatic Rings: 3Heavy Atoms: 23QED Weighted: 0.69Np Likeness Score: -0.12

References

1. Credille CV, Chen Y, Cohen SM..  (2016)  Fragment-Based Identification of Influenza Endonuclease Inhibitors.,  59  (13): [PMID:27291165] [10.1021/acs.jmedchem.6b00628]

Source