The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2,2-difluoro-2-(3-((R)-1-(7-methoxy-2-methyl-6-((R)-tetrahydrofuran-3-yloxy)quinazolin-4-ylamino)ethyl)phenyl)ethanol ID: ALA4540709
PubChem CID: 148949053
Max Phase: Preclinical
Molecular Formula: C24H27F2N3O4
Molecular Weight: 459.49
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc2nc(C)nc(N[C@H](C)c3cccc(C(F)(F)CO)c3)c2cc1O[C@@H]1CCOC1
Standard InChI: InChI=1S/C24H27F2N3O4/c1-14(16-5-4-6-17(9-16)24(25,26)13-30)27-23-19-10-22(33-18-7-8-32-12-18)21(31-3)11-20(19)28-15(2)29-23/h4-6,9-11,14,18,30H,7-8,12-13H2,1-3H3,(H,27,28,29)/t14-,18-/m1/s1
Standard InChI Key: PPMMZLFNJBDHFU-RDTXWAMCSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
5.5016 -2.8189 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5.9143 -3.5288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3227 -2.8164 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
6.6228 -3.9373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6216 -4.7569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3297 -5.1658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0393 -4.7564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0365 -3.9337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3279 -3.5285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3295 -5.9830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6217 -6.3915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0371 -6.3918 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.0369 -7.2090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3287 -7.6131 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.3281 -8.4295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0363 -8.8391 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.6201 -8.8376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7435 -7.6112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7431 -8.4260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4473 -8.8319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1525 -8.4243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1489 -7.6064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4441 -7.2042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8547 -7.1945 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.8509 -6.3774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8612 -8.8311 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.8632 -9.6483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5089 -5.8936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2527 -5.1175 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.4355 -5.1214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1867 -5.8997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2074 -3.9377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4996 -3.5293 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
6 10 1 0
10 11 1 6
10 12 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 19 1 0
18 13 1 0
15 17 1 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 18 2 0
22 24 1 0
25 24 1 6
21 26 1 0
26 27 1 0
25 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 25 1 0
4 2 1 0
2 32 1 0
32 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 459.49Molecular Weight (Monoisotopic): 459.1970AlogP: 4.37#Rotatable Bonds: 8Polar Surface Area: 85.73Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.69CX Basic pKa: 6.40CX LogP: 3.71CX LogD: 3.67Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.52Np Likeness Score: -0.58
References 1. (2018) Novel benzylamino substituted quinazolines and derivatives as sos1 inhibitors,