The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(4-(4-(3-bromophenyl)pyrimidin-2-yl)piperazine-1-carboxamido)phenyl sulfamate ID: ALA4540728
PubChem CID: 155549857
Max Phase: Preclinical
Molecular Formula: C21H21BrN6O4S
Molecular Weight: 533.41
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: NS(=O)(=O)Oc1ccc(NC(=O)N2CCN(c3nccc(-c4cccc(Br)c4)n3)CC2)cc1
Standard InChI: InChI=1S/C21H21BrN6O4S/c22-16-3-1-2-15(14-16)19-8-9-24-20(26-19)27-10-12-28(13-11-27)21(29)25-17-4-6-18(7-5-17)32-33(23,30)31/h1-9,14H,10-13H2,(H,25,29)(H2,23,30,31)
Standard InChI Key: SWDJCAPWJLXKGI-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
12.1217 -14.1110 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.5344 -13.4052 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
11.7127 -13.3966 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.7243 -8.8776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7231 -9.7013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4353 -10.1103 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.1449 -9.7008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1421 -8.8740 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.4335 -8.4646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8551 -10.1075 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.8544 -10.9298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5629 -11.3413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2765 -10.9310 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.2771 -10.1087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5642 -9.6968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9874 -11.3452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9856 -12.1666 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.7001 -10.9341 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.4111 -11.3484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4043 -12.1681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1144 -12.5782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8240 -12.1711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8232 -11.3456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1166 -10.9351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5355 -12.5803 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.2462 -13.8150 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.0129 -10.1096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3011 -9.6987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5894 -10.1061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5883 -10.9283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3048 -11.3414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0135 -10.9276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3070 -12.1627 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
10 11 1 0
10 15 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
7 10 1 0
13 16 1 0
16 17 2 0
16 18 1 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
22 25 1 0
25 2 1 0
2 26 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
5 27 1 0
31 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 533.41Molecular Weight (Monoisotopic): 532.0528AlogP: 2.84#Rotatable Bonds: 5Polar Surface Area: 130.75Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 10.75CX Basic pKa: 3.68CX LogP: 3.27CX LogD: 3.27Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.52Np Likeness Score: -1.80
References 1. Moi D, Foster PA, Rimmer LG, Jaffri A, Deplano A, Balboni G, Onnis V, Potter BVL.. (2019) Synthesis and in vitro evaluation of piperazinyl-ureido sulfamates as steroid sulfatase inhibitors., 182 [PMID:31422224 ] [10.1016/j.ejmech.2019.111614 ] 2. Nocentini A,Moi D,Deplano A,Osman SM,AlOthman ZA,Balboni G,Supuran CT,Onnis V. (2020) Sulfonamide/sulfamate switch with a series of piperazinylureido derivatives: Synthesis, kinetic and in silico evaluation as carbonic anhydrase isoforms I, II, IV, and IX inhibitors., 186 [PMID:31784185 ] [10.1016/j.ejmech.2019.111896 ]