The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2S)-isopropyl 2-((((2R,3R,4S,5R)-5-(6-amino-9H-purin-9-yl)-4-bromo-4-fluoro-3-hydroxytetrahydrofuran-2-yl)methoxy)(phenoxy)phosphorylamino)propanoate ID: ALA4540766
PubChem CID: 155550131
Max Phase: Preclinical
Molecular Formula: C22H27BrFN6O8P
Molecular Weight: 633.37
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)OC(=O)[C@H](C)NP(=O)(OC[C@H]1O[C@@H](n2cnc3c(=O)[nH]c(N)nc32)[C@](F)(Br)[C@H]1O)Oc1ccccc1
Standard InChI: InChI=1S/C22H27BrFN6O8P/c1-11(2)36-19(33)12(3)29-39(34,38-13-7-5-4-6-8-13)35-9-14-16(31)22(23,24)20(37-14)30-10-26-15-17(30)27-21(25)28-18(15)32/h4-8,10-12,14,16,20,31H,9H2,1-3H3,(H,29,34)(H3,25,27,28,32)/t12-,14+,16-,20+,22-,39?/m0/s1
Standard InChI Key: DYLSVKLQSKKAAB-GFHVOXQRSA-N
Molfile:
RDKit 2D
39 42 0 0 0 0 0 0 0 0999 V2000
9.1379 -3.9169 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
8.3421 -3.7043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5560 -4.4998 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
7.5212 -3.7043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6030 -2.9202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9337 -2.4335 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.2687 -2.9202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4839 -2.6657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3119 -1.8587 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.0353 -4.3712 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.3880 -2.6664 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.4687 -1.8834 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.6436 -1.8824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7226 -2.6685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0531 -3.1506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1366 -3.9695 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.8891 -4.3073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5588 -3.8201 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.4718 -3.0030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1392 -2.5180 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.9742 -5.1279 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.5272 -1.6041 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
5.3552 -0.7972 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.9143 -2.1564 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.5211 -2.4251 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.3045 -3.2209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5051 -3.4288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2883 -4.2239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8695 -4.8105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6705 -4.5965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8836 -3.8019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1295 -1.9018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9577 -1.0949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5167 -2.4541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7319 -2.1995 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.6886 -3.2611 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.1190 -2.7519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3342 -2.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2909 -3.5589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
2 3 1 1
4 2 1 0
2 5 1 0
5 6 1 0
6 7 1 0
7 4 1 0
7 8 1 1
8 9 1 0
4 10 1 1
5 11 1 1
11 15 1 0
14 12 1 0
12 13 2 0
13 11 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 1 0
19 14 1 0
19 20 2 0
17 21 1 0
9 22 1 0
22 23 2 0
22 24 1 0
22 25 1 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
24 32 1 0
32 33 1 6
32 34 1 0
34 35 1 0
34 36 2 0
35 37 1 0
37 38 1 0
37 39 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 633.37Molecular Weight (Monoisotopic): 632.0795AlogP: 2.15#Rotatable Bonds: 10Polar Surface Area: 192.91Molecular Species: NEUTRALHBA: 12HBD: 4#RO5 Violations: 2HBA (Lipinski): 14HBD (Lipinski): 5#RO5 Violations (Lipinski): 2CX Acidic pKa: 9.89CX Basic pKa: 0.43CX LogP: 1.53CX LogD: 1.53Aromatic Rings: 3Heavy Atoms: 39QED Weighted: 0.14Np Likeness Score: 0.18
References 1. Mengshetti S, Zhou L, Sari O, De Schutter C, Zhang H, Cho JH, Tao S, Bassit LC, Verma K, Domaoal RA, Ehteshami M, Jiang Y, Ovadia R, Kasthuri M, Ollinger Russell O, McBrayer T, Whitaker T, Pattassery J, Pascual ML, Uher L, Lin BY, Lee S, Amblard F, Coats SJ, Schinazi RF.. (2019) Discovery of a Series of 2'-α-Fluoro,2'-β-bromo-ribonucleosides and Their Phosphoramidate Prodrugs as Potent Pan-Genotypic Inhibitors of Hepatitis C Virus., 62 (4): [PMID:30653317 ] [10.1021/acs.jmedchem.8b01300 ]