(Z)-5-((5-(4-chloro-3-nitrophenyl)furan-2-yl)methylene)-1-(furan-2-ylmethyl)pyrimidine-2,4,6(1H,3H,5H)-trione

ID: ALA4540810

PubChem CID: 2277393

Max Phase: Preclinical

Molecular Formula: C20H12ClN3O7

Molecular Weight: 441.78

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C1NC(=O)N(Cc2ccco2)C(=O)/C1=C\c1ccc(-c2ccc(Cl)c([N+](=O)[O-])c2)o1

Standard InChI:  InChI=1S/C20H12ClN3O7/c21-15-5-3-11(8-16(15)24(28)29)17-6-4-12(31-17)9-14-18(25)22-20(27)23(19(14)26)10-13-2-1-7-30-13/h1-9H,10H2,(H,22,25,27)/b14-9-

Standard InChI Key:  OGEJQLBTZOJZEI-ZROIWOOFSA-N

Molfile:  

 
     RDKit          2D

 31 34  0  0  0  0  0  0  0  0999 V2000
   44.6340  -10.6335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.6340  -11.4585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.3460  -11.8668    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   46.0580  -11.4585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   46.0580  -10.6335    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   45.3460  -10.2168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.3460   -9.3918    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   43.9201  -11.8720    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   46.7719  -11.8720    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   43.9183  -10.2231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.3460  -12.6918    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   46.0605  -13.1043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   46.1511  -13.9227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   46.9581  -14.0942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   47.3706  -13.3797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   46.8185  -12.7667    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   43.2050  -10.6376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.4488  -10.3086    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   41.8986  -10.9233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.3132  -11.6367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.1195  -11.4627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.0778  -10.8395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.7448  -10.0855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.9249  -10.0014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.4411  -10.6707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.7830  -11.4263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.6020  -11.5068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.6202  -10.5881    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   39.3024  -12.0969    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   38.4814  -12.0159    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   39.6428  -12.8483    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  6  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  2  8  2  0
  4  9  2  0
  1 10  2  0
  3 11  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 12  1  0
 10 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 17  2  0
 19 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
 25 28  1  0
 26 29  1  0
 29 30  1  0
 29 31  2  0
M  CHG  2  29   1  30  -1
M  END

Associated Targets(Human)

ENTPD5 Tbio Ectonucleoside triphosphate diphosphohydrolase 5 (478 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

pyrH Uridylate kinase (158 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 441.78Molecular Weight (Monoisotopic): 441.0364AlogP: 3.76#Rotatable Bonds: 5
Polar Surface Area: 135.90Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: HBA (Lipinski): 10HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 7.06CX Basic pKa: CX LogP: 2.96CX LogD: 2.47
Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.28Np Likeness Score: -1.84

References

1.  (2012)  Entpd5 inhibitors, 

Source