5-(6-(methylamino)pyrazin-2-yl)-N-(4-(4-methylpiperazin-1-yl)phenyl)-4-phenoxy-7H-pyrrolo[2,3-d]pyrimidin-2-amine

ID: ALA4540819

PubChem CID: 155550586

Max Phase: Preclinical

Molecular Formula: C28H29N9O

Molecular Weight: 507.60

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CNc1cncc(-c2c[nH]c3nc(Nc4ccc(N5CCN(C)CC5)cc4)nc(Oc4ccccc4)c23)n1

Standard InChI:  InChI=1S/C28H29N9O/c1-29-24-18-30-17-23(33-24)22-16-31-26-25(22)27(38-21-6-4-3-5-7-21)35-28(34-26)32-19-8-10-20(11-9-19)37-14-12-36(2)13-15-37/h3-11,16-18H,12-15H2,1-2H3,(H,29,33)(H2,31,32,34,35)

Standard InChI Key:  KIQPGNPOPVJIBS-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 38 43  0  0  0  0  0  0  0  0999 V2000
   42.4719   -2.2864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.4707   -3.1060    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   43.1788   -3.5149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.1770   -1.8776    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   43.8856   -2.2828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.8904   -3.1015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.6705   -3.3499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.1478   -2.6848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.6627   -2.0254    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   41.7641   -1.8780    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   41.0565   -2.2868    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.3488   -1.8766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.6417   -2.2847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.6414   -3.1028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.3542   -3.5110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.0584   -3.1006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.9343   -3.5125    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   43.1798   -4.3321    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   42.4727   -4.7416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.2276   -3.1009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.5226   -3.5071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.5197   -4.3246    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   38.2279   -4.7343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.9390   -4.3264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.7677   -4.3334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.0610   -4.7422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.0616   -5.5603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.7748   -5.9678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.4786   -5.5566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.9262   -4.1210    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.3812   -4.7314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.6377   -5.5065    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   45.4387   -5.6724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.9828   -5.0570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.7235   -4.2843    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   46.7837   -5.2195    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   47.0435   -5.9943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.8110   -4.7316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9  5  1  0
  1 10  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
 14 17  1  0
  3 18  1  0
 18 19  1  0
 17 20  1  0
 17 24  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 19 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 19  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 30  1  0
  7 30  1  0
 34 36  1  0
 36 37  1  0
 22 38  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4540819

    ---

Associated Targets(Human)

ITK Tclin Tyrosine-protein kinase ITK/TSK (3699 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 507.60Molecular Weight (Monoisotopic): 507.2495AlogP: 4.74#Rotatable Bonds: 7
Polar Surface Area: 107.12Molecular Species: NEUTRALHBA: 9HBD: 3
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 10.86CX Basic pKa: 7.81CX LogP: 4.35CX LogD: 3.65
Aromatic Rings: 5Heavy Atoms: 38QED Weighted: 0.29Np Likeness Score: -1.14

References

1. Tang G, Liu L, Wang X, Pan Z..  (2019)  Discovery of 7H-pyrrolo[2,3-d]pyrimidine derivatives as selective covalent irreversible inhibitors of interleukin-2-inducible T-cell kinase (Itk).,  173  [PMID:30999237] [10.1016/j.ejmech.2019.03.055]

Source