The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-(4-bromophenyl)-N-(methylsulfamoyl)-6-[2-(5-methylsulfanylpyrimidin-2-yl)oxyethoxy]pyrimidin-4-amine ID: ALA4540866
PubChem CID: 21041288
Max Phase: Preclinical
Molecular Formula: C18H19BrN6O4S2
Molecular Weight: 527.43
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CNS(=O)(=O)Nc1ncnc(OCCOc2ncc(SC)cn2)c1-c1ccc(Br)cc1
Standard InChI: InChI=1S/C18H19BrN6O4S2/c1-20-31(26,27)25-16-15(12-3-5-13(19)6-4-12)17(24-11-23-16)28-7-8-29-18-21-9-14(30-2)10-22-18/h3-6,9-11,20H,7-8H2,1-2H3,(H,23,24,25)
Standard InChI Key: KSGHGYRWLMKYNA-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 33 0 0 0 0 0 0 0 0999 V2000
24.7551 -9.9466 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.1678 -10.6565 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
25.5763 -9.9441 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.1747 -12.2908 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.1735 -13.1104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8816 -13.5193 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.5912 -13.1099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5884 -12.2872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8798 -11.8820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2996 -13.5174 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.3009 -14.3346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0092 -14.7421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8773 -11.0648 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.4619 -11.0690 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.0105 -15.5593 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.7521 -10.6642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7188 -15.9667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7158 -16.7824 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.4233 -17.1898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1313 -16.7800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1274 -15.9586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4193 -15.5549 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.8402 -17.1866 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
27.2915 -11.8773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0011 -12.2849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7068 -11.8743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7041 -11.0563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9899 -10.6505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2871 -11.0634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4097 -10.6441 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
31.5468 -16.7759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
7 10 1 0
10 11 1 0
11 12 1 0
9 13 1 0
13 2 1 0
2 14 1 0
12 15 1 0
14 16 1 0
15 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
20 23 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
8 24 1 0
27 30 1 0
23 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 527.43Molecular Weight (Monoisotopic): 526.0093AlogP: 2.75#Rotatable Bonds: 10Polar Surface Area: 128.22Molecular Species: NEUTRALHBA: 9HBD: 2#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 7.77CX Basic pKa: 3.26CX LogP: 2.67CX LogD: 2.53Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.30Np Likeness Score: -1.21
References 1. Boss C, Bolli MH, Gatfield J.. (2016) From bosentan (Tracleer®) to macitentan (Opsumit®): The medicinal chemistry perspective., 26 (15): [PMID:27321813 ] [10.1016/j.bmcl.2016.06.014 ]