The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(2-(benzyloxy)ethyl)-N-(3,4-dimethoxyphenyl)-5-methoxy-2,2-dimethyl-2H-chromene-6-carboxamide ID: ALA4541006
PubChem CID: 155551290
Max Phase: Preclinical
Molecular Formula: C30H33NO6
Molecular Weight: 503.60
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(N(CCOCc2ccccc2)C(=O)c2ccc3c(c2OC)C=CC(C)(C)O3)cc1OC
Standard InChI: InChI=1S/C30H33NO6/c1-30(2)16-15-23-25(37-30)14-12-24(28(23)35-5)29(32)31(17-18-36-20-21-9-7-6-8-10-21)22-11-13-26(33-3)27(19-22)34-4/h6-16,19H,17-18,20H2,1-5H3
Standard InChI Key: KNMJCJKFNVBIGW-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 40 0 0 0 0 0 0 0 0999 V2000
27.7886 -21.5813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9714 -21.5813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3800 -22.2890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3157 -18.3290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3146 -19.1485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0226 -19.5575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7323 -19.1480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7295 -18.3254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0208 -17.9201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0184 -17.1029 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.7249 -16.6922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6079 -17.9206 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.6077 -17.1034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4406 -19.5555 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.1477 -19.1458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8560 -19.5533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1464 -18.3286 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.8527 -20.3689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2643 -19.5452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5563 -19.1415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2683 -20.3666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5638 -20.7739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5644 -21.5831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2677 -21.9911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9732 -20.7685 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.1454 -20.7782 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.1461 -21.5954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4419 -20.3727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7348 -20.7824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7361 -21.5996 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.0291 -22.0093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3207 -21.6018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3216 -20.7876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6141 -20.3802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9061 -20.7900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9100 -21.6114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6181 -22.0151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
9 10 1 0
10 11 1 0
4 12 1 0
12 13 1 0
7 14 1 0
14 15 1 0
15 16 1 0
15 17 2 0
16 18 2 0
18 22 1 0
21 19 1 0
19 20 2 0
20 16 1 0
21 22 2 0
21 25 1 0
22 23 1 0
23 24 2 0
24 2 1 0
2 25 1 0
18 26 1 0
26 27 1 0
14 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 503.60Molecular Weight (Monoisotopic): 503.2308AlogP: 5.76#Rotatable Bonds: 10Polar Surface Area: 66.46Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 5.03CX LogD: 5.03Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.33Np Likeness Score: 0.07
References 1. Kim HS, Hoang VH, Hong M, Chul Kim K, Ann J, Nguyen CT, Seo JH, Choi H, Yong Kim J, Kim KW, Sub Byun W, Lee S, Lee S, Suh YG, Chen J, Park HJ, Cho TM, Kim JY, Seo JH, Lee J.. (2019) Investigation of B,C-ring truncated deguelin derivatives as heat shock protein 90 (HSP90) inhibitors for use as anti-breast cancer agents., 27 (7): [PMID:30827868 ] [10.1016/j.bmc.2019.02.040 ]