The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-4-methyl-N-((S)-1-(((S)-4-methyl-1-((R)-2-methyloxiran-2-yl)-1-oxopentan-2-yl)amino)-1-oxo-3-phenylpropan-2-yl)-2-((S)-2-(2-morpholinoacetamido)-3-(thiazol-4-yl)propanamido)pentanamide ID: ALA4541035
PubChem CID: 147335182
Max Phase: Preclinical
Molecular Formula: C36H52N6O7S
Molecular Weight: 712.91
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)C[C@H](NC(=O)[C@H](Cc1cscn1)NC(=O)CN1CCOCC1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CC(C)C)C(=O)[C@@]1(C)CO1
Standard InChI: InChI=1S/C36H52N6O7S/c1-23(2)15-27(32(44)36(5)21-49-36)39-34(46)29(17-25-9-7-6-8-10-25)41-33(45)28(16-24(3)4)40-35(47)30(18-26-20-50-22-37-26)38-31(43)19-42-11-13-48-14-12-42/h6-10,20,22-24,27-30H,11-19,21H2,1-5H3,(H,38,43)(H,39,46)(H,40,47)(H,41,45)/t27-,28-,29-,30-,36+/m0/s1
Standard InChI Key: DCKRHEMOJZTVFP-VBBSPCATSA-N
Molfile:
RDKit 2D
50 53 0 0 0 0 0 0 0 0999 V2000
19.9098 -4.0694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6216 -3.6609 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.3376 -4.0694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9098 -4.8949 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.1979 -3.6609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0535 -3.6609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7695 -4.0694 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.4854 -3.6609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2014 -4.0694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9174 -3.6609 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.6251 -4.0694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3410 -3.6609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0570 -4.0694 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.7730 -3.6608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4889 -4.0694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2049 -3.6608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0297 -3.6609 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.6128 -2.9449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6087 -4.3625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0535 -2.8354 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.3376 -4.8949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4854 -2.8354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7730 -2.8354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3410 -2.8354 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.4889 -4.8949 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.2014 -4.8949 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.4871 -4.0712 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.7768 -3.6620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0681 -4.0689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0659 -4.8906 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.7786 -5.3037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4935 -4.8910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1973 -2.4227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1973 -1.6014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9091 -2.8354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4848 -2.4227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4848 -1.6014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1966 -2.6002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0494 -5.3076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1391 -6.1220 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.8043 -4.9687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6240 -4.8908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3354 -5.3044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3321 -6.1259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0426 -6.5353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7559 -6.1275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7543 -5.3020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0432 -4.8921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3553 -5.5801 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
22.9429 -6.2877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
1 4 2 0
1 5 1 0
3 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
18 17 1 0
16 18 1 0
16 19 1 6
6 20 2 0
3 21 1 6
8 22 1 1
14 23 1 1
12 24 2 0
15 25 2 0
9 26 2 0
5 27 1 0
27 28 1 0
27 32 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
22 33 1 0
33 34 1 0
33 35 1 0
23 36 1 0
36 37 1 0
36 38 1 0
21 39 1 0
39 40 1 0
40 50 2 0
49 41 1 0
41 39 2 0
11 42 1 6
42 43 1 0
43 44 2 0
44 45 1 0
45 46 2 0
46 47 1 0
47 48 2 0
48 43 1 0
49 50 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 712.91Molecular Weight (Monoisotopic): 712.3618AlogP: 1.65#Rotatable Bonds: 19Polar Surface Area: 171.36Molecular Species: NEUTRALHBA: 10HBD: 4#RO5 Violations: 1HBA (Lipinski): 13HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.59CX Basic pKa: 4.89CX LogP: 2.44CX LogD: 2.44Aromatic Rings: 2Heavy Atoms: 50QED Weighted: 0.16Np Likeness Score: -0.54
References 1. Lei M, Zhang H, Miao H, Du X, Zhou H, Wang J, Wang X, Feng H, Shi J, Liu Z, Shen J, Zhu Y.. (2019) Preparation and biological evaluation of soluble tetrapeptide epoxyketone proteasome inhibitors., 27 (18): [PMID:31383629 ] [10.1016/j.bmc.2019.07.044 ]