ethyl 5-(4-((S)-3-(4-(2H-tetrazol-5-yl)phenylamino)-2-((1r,4S)-4-(aminomethyl)cyclohexanecarboxamido)-3-oxopropyl)phenyl)-6-methylpicolinate

ID: ALA4541084

PubChem CID: 91667569

Max Phase: Preclinical

Molecular Formula: C33H38N8O4

Molecular Weight: 610.72

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCOC(=O)c1ccc(-c2ccc(C[C@H](NC(=O)[C@H]3CC[C@H](CN)CC3)C(=O)Nc3ccc(-c4nn[nH]n4)cc3)cc2)c(C)n1

Standard InChI:  InChI=1S/C33H38N8O4/c1-3-45-33(44)28-17-16-27(20(2)35-28)23-8-4-21(5-9-23)18-29(37-31(42)25-10-6-22(19-34)7-11-25)32(43)36-26-14-12-24(13-15-26)30-38-40-41-39-30/h4-5,8-9,12-17,22,25,29H,3,6-7,10-11,18-19,34H2,1-2H3,(H,36,43)(H,37,42)(H,38,39,40,41)/t22-,25-,29-/m0/s1

Standard InChI Key:  MVYPPJBYNQHFFT-HTLVZCCDSA-N

Molfile:  

 
     RDKit          2D

 45 49  0  0  0  0  0  0  0  0999 V2000
    3.7228  -13.9583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7228  -14.7755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4280  -15.1799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1333  -14.7755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1333  -13.9583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4280  -13.5456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4280  -12.7284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1357  -12.3198    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.7203  -12.3198    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.8435  -12.7284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5512  -12.3198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2589  -12.7284    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.5512  -11.5026    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.8435  -13.5456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5512  -13.9542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5472  -14.7724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2540  -15.1809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9627  -14.7723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9601  -13.9509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2526  -13.5460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6699  -15.1799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6696  -15.9982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3771  -16.4058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0852  -15.9962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0815  -15.1748    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.3735  -14.7709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3702  -13.9537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7940  -16.4029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7962  -17.2201    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.9666  -12.3198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4280  -15.9971    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7203  -16.4057    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.6733  -12.7322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6683  -11.0978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9640  -11.5080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3804  -11.5018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3764  -12.3204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5006  -15.9924    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.2094  -16.3991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9160  -15.9887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0880  -11.0896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8350  -11.4210    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.3810  -10.8130    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.9715  -10.1057    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.1724  -10.2768    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  6  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  6
  7  8  1  0
  7  9  2  0
  8 10  1  0
 10 11  1  0
 11 12  1  0
 11 13  2  0
 10 14  1  6
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
 18 21  1  0
 26 27  1  0
 24 28  1  0
 28 29  2  0
 12 30  1  0
  3 31  1  1
 31 32  1  0
 30 33  2  0
 33 37  1  0
 36 34  1  0
 34 35  2  0
 35 30  1  0
 36 37  2  0
 28 38  1  0
 38 39  1  0
 39 40  1  0
 41 42  1  0
 42 43  2  0
 43 44  1  0
 44 45  1  0
 45 41  2  0
 36 41  1  0
M  END

Associated Targets(Human)

PLG Tclin Plasminogen (2339 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
F11 Tchem Coagulation factor XI (1733 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 610.72Molecular Weight (Monoisotopic): 610.3016AlogP: 3.84#Rotatable Bonds: 11
Polar Surface Area: 177.87Molecular Species: ZWITTERIONHBA: 9HBD: 4
#RO5 Violations: 1HBA (Lipinski): 12HBD (Lipinski): 5#RO5 Violations (Lipinski): 2
CX Acidic pKa: 5.94CX Basic pKa: 10.22CX LogP: 2.62CX LogD: 2.61
Aromatic Rings: 4Heavy Atoms: 45QED Weighted: 0.18Np Likeness Score: -1.10

References

1. Steinmetzer T, Pilgram O, Wenzel BM, Wiedemeyer SJA..  (2020)  Fibrinolysis Inhibitors: Potential Drugs for the Treatment and Prevention of Bleeding.,  63  (4): [PMID:31658420] [10.1021/acs.jmedchem.9b01060]

Source