The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-N-(3-Ethyl-5-(4-methyl-1H-imidazol-1-yl)phenyl)-2-(methyl(pyrimidin-5-yl)amino)-2,3-dihydro-1H-indene-5-carboxamide ID: ALA4541139
PubChem CID: 155551408
Max Phase: Preclinical
Molecular Formula: C27H28N6O
Molecular Weight: 452.56
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCc1cc(NC(=O)c2ccc3c(c2)C[C@H](N(C)c2cncnc2)C3)cc(-n2cnc(C)c2)c1
Standard InChI: InChI=1S/C27H28N6O/c1-4-19-7-23(12-25(8-19)33-15-18(2)30-17-33)31-27(34)21-6-5-20-10-24(11-22(20)9-21)32(3)26-13-28-16-29-14-26/h5-9,12-17,24H,4,10-11H2,1-3H3,(H,31,34)/t24-/m1/s1
Standard InChI Key: SBGAHKXLTGCPRN-XMMPIXPASA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
21.5382 -3.6237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2546 -3.2103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2518 -2.3797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5364 -1.9706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8233 -3.2108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8245 -2.3865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0410 -2.1305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5554 -2.7967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0390 -3.4643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9698 -3.6217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9712 -4.4468 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.6836 -3.2081 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.3988 -3.6195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3955 -4.4430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1098 -4.8543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8246 -4.4405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8206 -3.6112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1058 -3.2037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5330 -3.1951 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.2872 -3.5223 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8361 -2.9063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4200 -2.1940 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.6139 -2.3697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6570 -2.9884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7303 -2.7956 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.3167 -3.5095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4915 -3.5062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0781 -4.2193 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.4896 -4.9353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3189 -4.9339 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.7287 -4.2202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1120 -5.6838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3985 -6.0982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3188 -2.0805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5 1 1 0
1 2 2 0
2 3 1 0
3 4 2 0
4 6 1 0
5 6 2 0
6 7 1 0
8 7 1 0
8 9 1 0
9 5 1 0
2 10 1 0
10 11 2 0
10 12 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
17 19 1 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 19 1 0
21 24 1 0
8 25 1 6
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
15 32 1 0
32 33 1 0
25 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 452.56Molecular Weight (Monoisotopic): 452.2325AlogP: 4.39#Rotatable Bonds: 6Polar Surface Area: 75.94Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 5.91CX LogP: 4.21CX LogD: 4.20Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.47Np Likeness Score: -1.41
References 1. Zhu D, Huang H, Pinkas DM, Luo J, Ganguly D, Fox AE, Arner E, Xiang Q, Tu ZC, Bullock AN, Brekken RA, Ding K, Lu X.. (2019) 2-Amino-2,3-dihydro-1H -indene-5-carboxamide-Based Discoidin Domain Receptor 1 (DDR1) Inhibitors: Design, Synthesis, and in Vivo Antipancreatic Cancer Efficacy., 62 (16): [PMID:31310125 ] [10.1021/acs.jmedchem.9b00365 ]