1-((4-(benzoxazole-2-yl)phenyl)amino)-3-((4-isopropylphenyl)amino)propan-2-ol

ID: ALA4541155

PubChem CID: 155551611

Max Phase: Preclinical

Molecular Formula: C25H27N3O2

Molecular Weight: 401.51

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(C)c1ccc(NCC(O)CNc2ccc(-c3nc4ccccc4o3)cc2)cc1

Standard InChI:  InChI=1S/C25H27N3O2/c1-17(2)18-7-11-20(12-8-18)26-15-22(29)16-27-21-13-9-19(10-14-21)25-28-23-5-3-4-6-24(23)30-25/h3-14,17,22,26-27,29H,15-16H2,1-2H3

Standard InChI Key:  MEMDECAXUSXCIN-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
    5.8799  -15.5390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8787  -16.3585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5868  -16.7675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2964  -16.3580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2936  -15.5354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5850  -15.1301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1716  -15.1268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0859  -14.3141    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.4251  -15.4593    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8781  -14.8523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2862  -14.1468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8794  -13.4427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0646  -13.4429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6583  -14.1530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0675  -14.8542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0048  -16.7655    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.7119  -16.3558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4202  -16.7633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1273  -16.3536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4215  -17.5805    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.8356  -16.7611    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.5427  -16.3514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2482  -16.7591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9548  -16.3500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9539  -15.5320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2406  -15.1247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5370  -15.5360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6605  -15.1213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3694  -15.5279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6581  -14.3041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7  8  2  0
  8 11  1  0
 10  9  1  0
  9  7  1  0
  1  7  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 10  1  0
  4 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 18 20  1  0
 19 21  1  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
 25 28  1  0
 28 29  1  0
 28 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4541155

    ---

Associated Targets(Human)

BCHE Tclin Butyrylcholinesterase (7174 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Mus musculus (284745 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ache Acetylcholinesterase (12221 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 401.51Molecular Weight (Monoisotopic): 401.2103AlogP: 5.50#Rotatable Bonds: 8
Polar Surface Area: 70.32Molecular Species: NEUTRALHBA: 5HBD: 3
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 4.53CX LogP: 4.71CX LogD: 4.71
Aromatic Rings: 4Heavy Atoms: 30QED Weighted: 0.36Np Likeness Score: -0.85

References

1. Srivastava P, Tripathi PN, Sharma P, Rai SN, Singh SP, Srivastava RK, Shankar S, Shrivastava SK..  (2019)  Design and development of some phenyl benzoxazole derivatives as a potent acetylcholinesterase inhibitor with antioxidant property to enhance learning and memory.,  163  [PMID:30503937] [10.1016/j.ejmech.2018.11.049]

Source