The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(6-(1-methyl-1H-indol-5-yl)pyrazolo[1,5-a]pyrimidin-3-yl)-N-(2,2,2-trifluoroethyl)thiophene-2-carboxamide ID: ALA4541288
PubChem CID: 155551158
Max Phase: Preclinical
Molecular Formula: C22H16F3N5OS
Molecular Weight: 455.47
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cn1ccc2ccc(-c3cnc4c(-c5csc(C(=O)NCC(F)(F)F)c5)cnn4c3)cc21
Standard InChI: InChI=1S/C22H16F3N5OS/c1-29-5-4-13-2-3-14(6-18(13)29)16-8-26-20-17(9-28-30(20)10-16)15-7-19(32-11-15)21(31)27-12-22(23,24)25/h2-11H,12H2,1H3,(H,27,31)
Standard InChI Key: FJGCZPIXTJBNIZ-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 36 0 0 0 0 0 0 0 0999 V2000
18.7005 -10.5409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7005 -11.3581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4058 -11.7626 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.4058 -10.1282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1110 -10.5409 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.1110 -11.3591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8892 -11.6121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3702 -10.9501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8892 -10.2882 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.1433 -12.3934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6629 -13.0545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1432 -13.7157 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
21.9205 -13.4632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9204 -12.6460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5816 -13.9435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4962 -14.7562 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.3281 -13.6111 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.9893 -14.0915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7358 -13.7591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3969 -14.2394 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
24.8212 -12.9464 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
25.4402 -13.3433 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
17.9940 -10.1365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9929 -9.3182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2848 -8.9118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2910 -10.5467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5824 -10.1439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5784 -9.3252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7985 -9.0759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3204 -9.7407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8050 -10.4006 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.5562 -11.1791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 4 2 0
2 3 2 0
3 6 1 0
5 4 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 5 1 0
10 11 2 0
11 12 1 0
12 13 1 0
13 14 2 0
14 10 1 0
7 10 1 0
13 15 1 0
15 16 2 0
15 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
19 21 1 0
19 22 1 0
23 24 2 0
24 25 1 0
25 28 2 0
27 26 2 0
26 23 1 0
1 23 1 0
27 28 1 0
28 29 1 0
29 30 2 0
30 31 1 0
31 27 1 0
31 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 455.47Molecular Weight (Monoisotopic): 455.1028AlogP: 4.91#Rotatable Bonds: 4Polar Surface Area: 64.22Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.90CX Basic pKa: 0.98CX LogP: 4.21CX LogD: 4.21Aromatic Rings: 5Heavy Atoms: 32QED Weighted: 0.42Np Likeness Score: -1.81
References 1. Sloman DL, Noucti N, Altman MD, Chen D, Mislak AC, Szewczak A, Hayashi M, Warren L, Dellovade T, Wu Z, Marcus J, Walker D, Su HP, Edavettal SC, Munshi S, Hutton M, Nuthall H, Stanton MG.. (2016) Optimization of microtubule affinity regulating kinase (MARK) inhibitors with improved physical properties., 26 (17): [PMID:27491711 ] [10.1016/j.bmcl.2016.02.003 ]