4-(6-(1-methyl-1H-indol-5-yl)pyrazolo[1,5-a]pyrimidin-3-yl)-N-(2,2,2-trifluoroethyl)thiophene-2-carboxamide

ID: ALA4541288

PubChem CID: 155551158

Max Phase: Preclinical

Molecular Formula: C22H16F3N5OS

Molecular Weight: 455.47

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cn1ccc2ccc(-c3cnc4c(-c5csc(C(=O)NCC(F)(F)F)c5)cnn4c3)cc21

Standard InChI:  InChI=1S/C22H16F3N5OS/c1-29-5-4-13-2-3-14(6-18(13)29)16-8-26-20-17(9-28-30(20)10-16)15-7-19(32-11-15)21(31)27-12-22(23,24)25/h2-11H,12H2,1H3,(H,27,31)

Standard InChI Key:  FJGCZPIXTJBNIZ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 36  0  0  0  0  0  0  0  0999 V2000
   18.7005  -10.5409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7005  -11.3581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4058  -11.7626    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.4058  -10.1282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1110  -10.5409    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.1110  -11.3591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8892  -11.6121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3702  -10.9501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8892  -10.2882    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.1433  -12.3934    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6629  -13.0545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1432  -13.7157    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   21.9205  -13.4632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9204  -12.6460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5816  -13.9435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4962  -14.7562    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.3281  -13.6111    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.9893  -14.0915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7358  -13.7591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3969  -14.2394    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   24.8212  -12.9464    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   25.4402  -13.3433    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   17.9940  -10.1365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9929   -9.3182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2848   -8.9118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2910  -10.5467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5824  -10.1439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5784   -9.3252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7985   -9.0759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3204   -9.7407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8050  -10.4006    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.5562  -11.1791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  4  2  0
  2  3  2  0
  3  6  1  0
  5  4  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  5  1  0
 10 11  2  0
 11 12  1  0
 12 13  1  0
 13 14  2  0
 14 10  1  0
  7 10  1  0
 13 15  1  0
 15 16  2  0
 15 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 19 21  1  0
 19 22  1  0
 23 24  2  0
 24 25  1  0
 25 28  2  0
 27 26  2  0
 26 23  1  0
  1 23  1  0
 27 28  1  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 27  1  0
 31 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4541288

    ---

Associated Targets(Human)

MARK3 Tchem Serine/threonine-protein kinase c-TAK1 (2532 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 455.47Molecular Weight (Monoisotopic): 455.1028AlogP: 4.91#Rotatable Bonds: 4
Polar Surface Area: 64.22Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 13.90CX Basic pKa: 0.98CX LogP: 4.21CX LogD: 4.21
Aromatic Rings: 5Heavy Atoms: 32QED Weighted: 0.42Np Likeness Score: -1.81

References

1. Sloman DL, Noucti N, Altman MD, Chen D, Mislak AC, Szewczak A, Hayashi M, Warren L, Dellovade T, Wu Z, Marcus J, Walker D, Su HP, Edavettal SC, Munshi S, Hutton M, Nuthall H, Stanton MG..  (2016)  Optimization of microtubule affinity regulating kinase (MARK) inhibitors with improved physical properties.,  26  (17): [PMID:27491711] [10.1016/j.bmcl.2016.02.003]

Source