The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Benzyl 4-((2S,5S)-5-benzyl-3,6-dioxopiperazin-2-yl)butylcarbamate ID: ALA4541389
PubChem CID: 155551300
Max Phase: Preclinical
Molecular Formula: C23H27N3O4
Molecular Weight: 409.49
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C(NCCCC[C@@H]1NC(=O)[C@H](Cc2ccccc2)NC1=O)OCc1ccccc1
Standard InChI: InChI=1S/C23H27N3O4/c27-21-19(25-22(28)20(26-21)15-17-9-3-1-4-10-17)13-7-8-14-24-23(29)30-16-18-11-5-2-6-12-18/h1-6,9-12,19-20H,7-8,13-16H2,(H,24,29)(H,25,28)(H,26,27)/t19-,20-/m0/s1
Standard InChI Key: UHMCEECTPACGCN-PMACEKPBSA-N
Molfile:
RDKit 2D
30 32 0 0 0 0 0 0 0 0999 V2000
21.9032 -9.3234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9032 -10.1406 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.6085 -10.5451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3138 -10.1406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3138 -9.3234 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.6085 -8.9107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6085 -8.0935 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.6085 -11.3623 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.0209 -10.5502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1943 -8.9169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7292 -10.1427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4878 -9.3276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4363 -10.5523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1446 -10.1447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8517 -10.5543 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.5600 -10.1468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2671 -10.5564 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.5612 -9.3296 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.9754 -10.1488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6825 -10.5584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6791 -11.3757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3854 -11.7852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0946 -11.3776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0932 -10.5562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3863 -10.1504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7795 -8.9179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0734 -9.3279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0754 -10.1460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7893 -10.5523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4924 -10.1400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 6 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 2 0
3 8 2 0
4 9 1 1
1 10 1 1
9 11 1 0
10 12 1 0
11 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
16 18 2 0
17 19 1 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
12 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 12 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 409.49Molecular Weight (Monoisotopic): 409.2002AlogP: 2.31#Rotatable Bonds: 9Polar Surface Area: 96.53Molecular Species: NEUTRALHBA: 4HBD: 3#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.84CX Basic pKa: ┄CX LogP: 2.61CX LogD: 2.61Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.55Np Likeness Score: 0.22
References 1. Simon G, Bérubé C, Voyer N, Grenier D.. (2019) Anti-biofilm and anti-adherence properties of novel cyclic dipeptides against oral pathogens., 27 (12): [PMID:30528685 ] [10.1016/j.bmc.2018.11.042 ]