Methyl-(E)-3-(3-(4-(N,N-dibutylsulfamoyl)phenyl)-3-oxoprop-1-en-1-yl)benzoate

ID: ALA4541398

PubChem CID: 155551304

Max Phase: Preclinical

Molecular Formula: C25H31NO5S

Molecular Weight: 457.59

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCCN(CCCC)S(=O)(=O)c1ccc(C(=O)/C=C/c2cccc(C(=O)OC)c2)cc1

Standard InChI:  InChI=1S/C25H31NO5S/c1-4-6-17-26(18-7-5-2)32(29,30)23-14-12-21(13-15-23)24(27)16-11-20-9-8-10-22(19-20)25(28)31-3/h8-16,19H,4-7,17-18H2,1-3H3/b16-11+

Standard InChI Key:  FDSCLXYXRNRZCN-LFIBNONCSA-N

Molfile:  

 
     RDKit          2D

 32 33  0  0  0  0  0  0  0  0999 V2000
   14.1935  -12.7160    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.6063  -12.0102    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   13.7887  -12.0057    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.3147  -12.4188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3136  -13.2383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0216  -13.6473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7313  -13.2379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7285  -12.4152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0198  -12.0099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4396  -13.6453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4409  -14.4625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.1467  -13.2356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1454  -12.4184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8525  -12.0087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5585  -12.4172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2650  -12.0082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2642  -11.1901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5509  -10.7828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8472  -11.1942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5467   -9.9657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2523   -9.5535    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.8369   -9.5607    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.8328   -8.7435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6067  -11.1932    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.3147  -10.7850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3151   -9.9678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0231   -9.5596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0235   -8.7424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8992  -10.7842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8997   -9.9670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1922   -9.5580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1927   -8.7408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
  7 10  1  0
 10 11  2  0
 10 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 18 20  1  0
 20 21  2  0
 20 22  1  0
 22 23  1  0
  4  2  1  0
  2 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 24 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4541398

    ---

Associated Targets(Human)

P4HB Tchem Protein disulfide-isomerase (716 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 457.59Molecular Weight (Monoisotopic): 457.1923AlogP: 4.96#Rotatable Bonds: 12
Polar Surface Area: 80.75Molecular Species: NEUTRALHBA: 5HBD:
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 5.59CX LogD: 5.59
Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.26Np Likeness Score: -0.76

References

1. Yang S, Shergalis A, Lu D, Kyani A, Liu Z, Ljungman M, Neamati N..  (2019)  Design, Synthesis, and Biological Evaluation of Novel Allosteric Protein Disulfide Isomerase Inhibitors.,  62  (7): [PMID:30759340] [10.1021/acs.jmedchem.8b01951]

Source