The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Methyl-(E)-3-(3-(4-(N,N-dibutylsulfamoyl)phenyl)-3-oxoprop-1-en-1-yl)benzoate ID: ALA4541398
PubChem CID: 155551304
Max Phase: Preclinical
Molecular Formula: C25H31NO5S
Molecular Weight: 457.59
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCCN(CCCC)S(=O)(=O)c1ccc(C(=O)/C=C/c2cccc(C(=O)OC)c2)cc1
Standard InChI: InChI=1S/C25H31NO5S/c1-4-6-17-26(18-7-5-2)32(29,30)23-14-12-21(13-15-23)24(27)16-11-20-9-8-10-22(19-20)25(28)31-3/h8-16,19H,4-7,17-18H2,1-3H3/b16-11+
Standard InChI Key: FDSCLXYXRNRZCN-LFIBNONCSA-N
Molfile:
RDKit 2D
32 33 0 0 0 0 0 0 0 0999 V2000
14.1935 -12.7160 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.6063 -12.0102 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
13.7887 -12.0057 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.3147 -12.4188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3136 -13.2383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0216 -13.6473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7313 -13.2379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7285 -12.4152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0198 -12.0099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4396 -13.6453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4409 -14.4625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.1467 -13.2356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1454 -12.4184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8525 -12.0087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5585 -12.4172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2650 -12.0082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2642 -11.1901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5509 -10.7828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8472 -11.1942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5467 -9.9657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2523 -9.5535 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.8369 -9.5607 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.8328 -8.7435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6067 -11.1932 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.3147 -10.7850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3151 -9.9678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0231 -9.5596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0235 -8.7424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8992 -10.7842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8997 -9.9670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1922 -9.5580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1927 -8.7408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
7 10 1 0
10 11 2 0
10 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 14 1 0
18 20 1 0
20 21 2 0
20 22 1 0
22 23 1 0
4 2 1 0
2 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
24 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 457.59Molecular Weight (Monoisotopic): 457.1923AlogP: 4.96#Rotatable Bonds: 12Polar Surface Area: 80.75Molecular Species: NEUTRALHBA: 5HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 5.59CX LogD: 5.59Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.26Np Likeness Score: -0.76
References 1. Yang S, Shergalis A, Lu D, Kyani A, Liu Z, Ljungman M, Neamati N.. (2019) Design, Synthesis, and Biological Evaluation of Novel Allosteric Protein Disulfide Isomerase Inhibitors., 62 (7): [PMID:30759340 ] [10.1021/acs.jmedchem.8b01951 ]