4-(((4-benzyl-5-ethyl-4H-1,2,4-triazol-3-yl)thio)methyl)-N-(4-fluorophenyl)benzamide

ID: ALA4541410

PubChem CID: 155551349

Max Phase: Preclinical

Molecular Formula: C25H23FN4OS

Molecular Weight: 446.55

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCc1nnc(SCc2ccc(C(=O)Nc3ccc(F)cc3)cc2)n1Cc1ccccc1

Standard InChI:  InChI=1S/C25H23FN4OS/c1-2-23-28-29-25(30(23)16-18-6-4-3-5-7-18)32-17-19-8-10-20(11-9-19)24(31)27-22-14-12-21(26)13-15-22/h3-15H,2,16-17H2,1H3,(H,27,31)

Standard InChI Key:  FDRUWELMXFLYSG-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 35  0  0  0  0  0  0  0  0999 V2000
    5.2752   -3.5364    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.9497   -3.0743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7187   -2.2900    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.9013   -2.2674    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.6274   -3.0377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2554   -4.3517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5380   -4.7430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8427   -4.3130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1258   -4.7036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1054   -5.5214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8080   -5.9470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5221   -5.5540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7196   -3.3483    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    7.3418   -2.8185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1117   -3.0924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2550   -3.8969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0241   -4.1709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6472   -3.6409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4962   -2.8335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7272   -2.5632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4175   -3.9138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5663   -4.7173    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.0390   -3.3832    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.8093   -3.6561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9537   -4.4580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7231   -4.7310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3455   -4.2001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1934   -3.3929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4241   -3.1237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8435   -3.2686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2516   -2.7052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1162   -4.4720    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  1  1  0
  1  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
  2 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
 18 21  1  0
 21 22  2  0
 21 23  1  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 24  1  0
  5 30  1  0
 30 31  1  0
 27 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4541410

    ---

Associated Targets(Human)

PDE6D Tclin Phosphodiesterase 6D (241 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 446.55Molecular Weight (Monoisotopic): 446.1577AlogP: 5.57#Rotatable Bonds: 8
Polar Surface Area: 59.81Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 2.13CX LogP: 5.83CX LogD: 5.83
Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.36Np Likeness Score: -2.27

References

1. Chen D, Chen Y, Lian F, Chen L, Li Y, Cao D, Wang X, Chen L, Li J, Meng T, Huang M, Geng M, Shen J, Zhang N, Xiong B..  (2019)  Fragment-based drug discovery of triazole inhibitors to block PDEδ-RAS protein-protein interaction.,  163  [PMID:30562696] [10.1016/j.ejmech.2018.12.018]

Source