The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Benzyl ((S)-4-methyl-1-(((S)-4-methyl-1-(((S)-5-methyl-1-(naphthalen-1-ylamino)-1,2-dioxohexan-3-yl)amino)-1-oxopentan-2-yl)amino)-1-oxopentan-2-yl)carbamate ID: ALA4541448
PubChem CID: 155551617
Max Phase: Preclinical
Molecular Formula: C37H48N4O6
Molecular Weight: 644.81
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)C[C@H](NC(=O)OCc1ccccc1)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)C(=O)Nc1cccc2ccccc12
Standard InChI: InChI=1S/C37H48N4O6/c1-23(2)19-30(33(42)36(45)38-29-18-12-16-27-15-10-11-17-28(27)29)39-34(43)31(20-24(3)4)40-35(44)32(21-25(5)6)41-37(46)47-22-26-13-8-7-9-14-26/h7-18,23-25,30-32H,19-22H2,1-6H3,(H,38,45)(H,39,43)(H,40,44)(H,41,46)/t30-,31-,32-/m0/s1
Standard InChI Key: MLLRFAQZDIFLTH-CPCREDONSA-N
Molfile:
RDKit 2D
47 49 0 0 0 0 0 0 0 0999 V2000
31.8127 -11.1084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5272 -10.6959 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.0982 -10.6959 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.8127 -11.9334 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.0982 -9.8709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3838 -9.4584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3867 -8.6324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6731 -8.2199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9577 -8.6325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9603 -9.4617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6746 -9.8704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2416 -11.1084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9561 -10.6959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6706 -11.1084 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.9561 -9.8709 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.2416 -11.9334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9512 -12.3429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9514 -13.1679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6656 -11.9302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3850 -10.6959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0995 -11.1084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3850 -9.8709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.1002 -9.4499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.8181 -9.8565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0933 -8.6250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0995 -11.9334 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.8141 -10.6959 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.5285 -11.1084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.2430 -10.6959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.5285 -11.9334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.2430 -9.8709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.9575 -9.4584 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.5285 -9.4584 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.2430 -12.3459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.2430 -13.1709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.9575 -11.9334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.9575 -11.1084 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.9575 -8.6334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.9590 -6.9842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.2422 -7.4011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.2453 -8.2240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.6741 -7.3976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.6727 -8.2190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.3823 -8.6292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.0938 -8.2189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.0912 -7.3943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.3810 -6.9879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 1 0
1 4 2 0
3 5 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 6 1 0
2 12 1 0
12 13 1 0
13 14 1 0
13 15 2 0
12 16 1 6
16 17 1 0
17 18 1 0
17 19 1 0
14 20 1 0
20 21 1 0
20 22 1 1
22 23 1 0
23 24 1 0
23 25 1 0
21 26 2 0
21 27 1 0
27 28 1 0
28 29 1 0
28 30 1 6
29 31 1 0
31 32 1 0
31 33 2 0
30 34 1 0
34 35 1 0
34 36 1 0
29 37 2 0
32 38 1 0
38 43 2 0
42 39 2 0
39 40 1 0
40 41 2 0
41 38 1 0
42 43 1 0
43 44 1 0
44 45 2 0
45 46 1 0
46 47 2 0
47 42 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 644.81Molecular Weight (Monoisotopic): 644.3574AlogP: 5.75#Rotatable Bonds: 16Polar Surface Area: 142.70Molecular Species: NEUTRALHBA: 6HBD: 4#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.18CX Basic pKa: ┄CX LogP: 6.99CX LogD: 6.99Aromatic Rings: 3Heavy Atoms: 47QED Weighted: 0.15Np Likeness Score: -0.41
References 1. Pacifico S, Ferretti V, Albanese V, Fantinati A, Gallerani E, Nicoli F, Gavioli R, Zamberlan F, Preti D, Marastoni M.. (2019) Synthesis and Biological Activity of Peptide α-Ketoamide Derivatives as Proteasome Inhibitors., 10 (7): [PMID:31312413 ] [10.1021/acsmedchemlett.9b00233 ]