2-(2-(4-(2-(3-(4-hydroxyphenyl)-1-methoxy-1-oxopropan-2-ylideneaminooxy)ethyl)-1H-1,2,3-triazol-1-yl)acetamido)-3-phenylpropanoic acid

ID: ALA4541475

PubChem CID: 155551104

Max Phase: Preclinical

Molecular Formula: C25H27N5O7

Molecular Weight: 509.52

Molecule Type: Unknown

Names and Identifiers

Canonical SMILES:  COC(=O)/C(Cc1ccc(O)cc1)=N\OCCc1cn(CC(=O)NC(Cc2ccccc2)C(=O)O)nn1

Standard InChI:  InChI=1S/C25H27N5O7/c1-36-25(35)22(14-18-7-9-20(31)10-8-18)28-37-12-11-19-15-30(29-27-19)16-23(32)26-21(24(33)34)13-17-5-3-2-4-6-17/h2-10,15,21,31H,11-14,16H2,1H3,(H,26,32)(H,33,34)/b28-22-

Standard InChI Key:  IRJOCKZIRXBSOO-SLMZUGIISA-N

Molfile:  

 
     RDKit          2D

 37 39  0  0  0  0  0  0  0  0999 V2000
    8.2902  -10.7060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2890  -11.5255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9971  -11.9345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7067  -11.5251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7039  -10.7024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9953  -10.2971    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4101  -10.2911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4070   -9.4739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1132   -9.0627    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.6978   -9.0680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6947   -8.2508    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.9916   -9.4793    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.8224   -9.4686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5286   -9.0574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8255  -10.2858    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.2378   -9.4633    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.3301  -10.2732    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.1301  -10.4401    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.5360   -9.7308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9869   -9.1257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3492   -9.7279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7552   -9.0187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5724   -9.0157    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.9784   -8.3066    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.7956   -8.3036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2016   -7.5944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2068   -9.0098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8007   -9.7190    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.0239   -9.0069    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.4351   -9.7131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7905   -6.8882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1993   -6.1839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7888   -5.4782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9708   -5.4807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5649   -6.1949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9777   -6.8977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5587   -4.7750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  5  7  1  0
  7  8  1  0
  8  9  1  0
  8 10  1  0
 10 11  2  0
 10 12  1  0
  9 13  1  0
 13 14  1  0
 13 15  2  0
 14 16  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 16  1  0
 19 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 25 27  1  0
 27 28  2  0
 27 29  1  0
 29 30  1  0
 26 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 35  1  0
 35 36  2  0
 36 31  1  0
 34 37  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA4541475

   ---

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Unknown

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 509.52

Molecular Weight (Monoisotopic): 509.1910

AlogP: 1.13

#Rotatable Bonds: 13

Polar Surface Area: 165.23

Molecular Species: ACID

HBA: 10

HBD: 3

#RO5 Violations: 1

HBA (Lipinski): 12

HBD (Lipinski): 3

#RO5 Violations (Lipinski): 2

CX Acidic pKa: 3.53

CX Basic pKa: 0.47

CX LogP: 3.05

CX LogD: -0.32

Aromatic Rings: 3

Heavy Atoms: 37

QED Weighted: 0.13

Np Likeness Score: -0.57

References

1. Prasher P, Sharma M..  (2019)  Tailored therapeutics based on 1,2,3-1H-triazoles: a mini review.,  10  (8): [PMID:31534652] [10.1039/C9MD00218A]

2. Raje, Mithun and 9 more authors.  2013-07-01  Synthesis of kojic acid derivatives as secondary binding site probes of D-amino acid oxidase.  [PMID:23683589]

3. Hin, Niyada and 10 more authors.  2015-09-24  6-Hydroxy-1,2,4-triazine-3,5(2H,4H)-dione Derivatives as Novel D-Amino Acid Oxidase Inhibitors.  [PMID:26309148]

4. Hin, Niyada and 8 more authors.  2016-04-15  D-Amino acid oxidase inhibitors based on the 5-hydroxy-1,2,4-triazin-6(1H)-one scaffold.  [PMID:26965861]

5. Kato, Yusuke and 9 more authors.  2018-11-05  Structural basis for potent inhibition of d-amino acid oxidase by thiophene carboxylic acids.  [PMID:30265959]

Source

Source(1):

• Scientific Literature