The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-[2-[3-(pentafluoro-lambda6-sulfanyl)phenyl]-4-quinolyl]-[(2S)-pyrrolidin-2-yl]methanol ID: ALA4541728
PubChem CID: 155551206
Max Phase: Preclinical
Molecular Formula: C20H19F5N2OS
Molecular Weight: 430.44
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O[C@H](c1cc(-c2cccc(S(F)(F)(F)(F)F)c2)nc2ccccc12)[C@@H]1CCCN1
Standard InChI: InChI=1S/C20H19F5N2OS/c21-29(22,23,24,25)14-6-3-5-13(11-14)19-12-16(20(28)18-9-4-10-26-18)15-7-1-2-8-17(15)27-19/h1-3,5-8,11-12,18,20,26,28H,4,9-10H2/t18-,20+/m0/s1
Standard InChI Key: XTNHAYOJSAOCDV-AZUAARDMSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
1.8269 -3.8796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8258 -4.7032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5380 -5.1163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5362 -3.4707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2489 -3.8760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2497 -4.6991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9624 -5.1103 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.6706 -4.6953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6659 -3.8691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9568 -3.4657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9524 -2.6444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6580 -2.2279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2384 -2.2355 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.4075 -2.5560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9553 -1.9458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5387 -1.2361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7404 -1.4104 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.6514 -3.0459 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
5.3805 -5.1012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3823 -5.9237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0949 -6.3294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8061 -5.9180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8003 -5.0925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0872 -4.6863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0977 -7.1507 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
5.3872 -7.5659 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
6.8109 -7.5610 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
6.0918 -7.9697 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
6.8058 -6.7356 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5.3819 -6.7398 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
10 11 1 0
11 12 1 0
11 13 1 1
12 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 12 1 0
12 18 1 6
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
8 19 1 0
21 25 1 0
25 26 1 0
25 27 1 0
25 28 1 0
25 29 1 0
25 30 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 430.44Molecular Weight (Monoisotopic): 430.1138AlogP: 6.34#Rotatable Bonds: 4Polar Surface Area: 45.15Molecular Species: BASEHBA: 3HBD: 2#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.87CX Basic pKa: 10.46CX LogP: 5.35CX LogD: 2.40Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.47Np Likeness Score: 0.02
References 1. Parrino B, Schillaci D, Carnevale I, Giovannetti E, Diana P, Cirrincione G, Cascioferro S.. (2019) Synthetic small molecules as anti-biofilm agents in the struggle against antibiotic resistance., 161 [PMID:30347328 ] [10.1016/j.ejmech.2018.10.036 ]