(R)-[2-[3-(pentafluoro-lambda6-sulfanyl)phenyl]-4-quinolyl]-[(2S)-pyrrolidin-2-yl]methanol

ID: ALA4541728

PubChem CID: 155551206

Max Phase: Preclinical

Molecular Formula: C20H19F5N2OS

Molecular Weight: 430.44

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O[C@H](c1cc(-c2cccc(S(F)(F)(F)(F)F)c2)nc2ccccc12)[C@@H]1CCCN1

Standard InChI:  InChI=1S/C20H19F5N2OS/c21-29(22,23,24,25)14-6-3-5-13(11-14)19-12-16(20(28)18-9-4-10-26-18)15-7-1-2-8-17(15)27-19/h1-3,5-8,11-12,18,20,26,28H,4,9-10H2/t18-,20+/m0/s1

Standard InChI Key:  XTNHAYOJSAOCDV-AZUAARDMSA-N

Molfile:  

 
     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
    1.8269   -3.8796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8258   -4.7032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5380   -5.1163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5362   -3.4707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2489   -3.8760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2497   -4.6991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9624   -5.1103    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.6706   -4.6953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6659   -3.8691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9568   -3.4657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9524   -2.6444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6580   -2.2279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2384   -2.2355    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.4075   -2.5560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9553   -1.9458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5387   -1.2361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7404   -1.4104    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.6514   -3.0459    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.3805   -5.1012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3823   -5.9237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0949   -6.3294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8061   -5.9180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8003   -5.0925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0872   -4.6863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0977   -7.1507    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    5.3872   -7.5659    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    6.8109   -7.5610    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    6.0918   -7.9697    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    6.8058   -6.7356    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    5.3819   -6.7398    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
 10 11  1  0
 11 12  1  0
 11 13  1  1
 12 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 12  1  0
 12 18  1  6
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 19  1  0
  8 19  1  0
 21 25  1  0
 25 26  1  0
 25 27  1  0
 25 28  1  0
 25 29  1  0
 25 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4541728

    ---

Associated Targets(non-human)

Vibrio cholerae (1211 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 430.44Molecular Weight (Monoisotopic): 430.1138AlogP: 6.34#Rotatable Bonds: 4
Polar Surface Area: 45.15Molecular Species: BASEHBA: 3HBD: 2
#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.87CX Basic pKa: 10.46CX LogP: 5.35CX LogD: 2.40
Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.47Np Likeness Score: 0.02

References

1. Parrino B, Schillaci D, Carnevale I, Giovannetti E, Diana P, Cirrincione G, Cascioferro S..  (2019)  Synthetic small molecules as anti-biofilm agents in the struggle against antibiotic resistance.,  161  [PMID:30347328] [10.1016/j.ejmech.2018.10.036]

Source