The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-[3,5-dimethyl-4-(4-pyridyloxy)phenyl]-1-(4-fluorophenyl)-2-oxo-pyridine-3-carboxamide ID: ALA4542026
PubChem CID: 155551127
Max Phase: Preclinical
Molecular Formula: C25H20FN3O3
Molecular Weight: 429.45
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cc(NC(=O)c2cccn(-c3ccc(F)cc3)c2=O)cc(C)c1Oc1ccncc1
Standard InChI: InChI=1S/C25H20FN3O3/c1-16-14-19(15-17(2)23(16)32-21-9-11-27-12-10-21)28-24(30)22-4-3-13-29(25(22)31)20-7-5-18(26)6-8-20/h3-15H,1-2H3,(H,28,30)
Standard InChI Key: KUDLEBZUOBVRGB-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
29.5413 -15.0919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2493 -14.6846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9576 -15.0913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9576 -15.9107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2519 -16.3214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5413 -15.9160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8332 -16.3237 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.8332 -17.1431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5412 -17.5552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5401 -18.3712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8317 -18.7790 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.1235 -18.3721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1208 -17.5533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2519 -17.1409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6657 -14.6836 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.6657 -13.8642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3737 -13.4565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3737 -12.6371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0859 -12.2253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.7940 -12.6371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.7940 -13.4565 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.0859 -13.8642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0859 -14.6836 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.5021 -13.8642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2104 -13.4568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.9190 -13.8636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.9190 -14.6834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2129 -15.0901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5021 -14.6887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.6270 -15.0911 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
30.9576 -13.4565 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.8332 -14.6842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
6 5 2 0
1 6 1 0
6 7 1 0
7 8 1 0
9 8 2 0
10 9 1 0
11 10 2 0
12 11 1 0
13 12 2 0
8 13 1 0
5 14 1 0
3 15 1 0
15 16 1 0
16 17 1 0
18 17 2 0
19 18 1 0
20 19 2 0
21 20 1 0
22 21 1 0
17 22 1 0
22 23 2 0
24 21 1 0
25 24 2 0
26 25 1 0
27 26 2 0
28 27 1 0
29 28 2 0
24 29 1 0
27 30 1 0
16 31 2 0
1 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 429.45Molecular Weight (Monoisotopic): 429.1489AlogP: 5.03#Rotatable Bonds: 5Polar Surface Area: 73.22Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.69CX Basic pKa: 5.95CX LogP: 4.37CX LogD: 4.36Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.48Np Likeness Score: -1.59
References 1. Hart AC, Abell L, Guo J, Mertzman ME, Padmanabha R, Macor JE, Chaudhry C, Lu H, O'Malley K, Shaw PJ, Weigelt C, Pokross M, Kish K, Kim KS, Cornelius L, Douglas AE, Calambur D, Zhang P, Carpenter B, Pitts WJ.. (2020) Identification of RIPK3 Type II Inhibitors Using High-Throughput Mechanistic Studies in Hit Triage., 11 (3): [PMID:32184955 ] [10.1021/acsmedchemlett.9b00065 ]