3-methoxy-4-(5-(4-(5-(pyridin-3-yl)-1,3,4-thiadiazol-2-yl)phenyl)-1,3,4-oxadiazol-2-yl)phenol

ID: ALA4542197

PubChem CID: 155551525

Max Phase: Preclinical

Molecular Formula: C22H15N5O3S

Molecular Weight: 429.46

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cc(O)ccc1-c1nnc(-c2ccc(-c3nnc(-c4cccnc4)s3)cc2)o1

Standard InChI:  InChI=1S/C22H15N5O3S/c1-29-18-11-16(28)8-9-17(18)20-25-24-19(30-20)13-4-6-14(7-5-13)21-26-27-22(31-21)15-3-2-10-23-12-15/h2-12,28H,1H3

Standard InChI Key:  ZJEMAQLDOPAUAZ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 31 35  0  0  0  0  0  0  0  0999 V2000
   24.9559   -9.3399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9548  -10.1594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6628  -10.5684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.3725  -10.1589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.3697   -9.3363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6610   -8.9310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.2468  -10.5675    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.6586   -8.1138    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.9497   -7.7073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.0736   -8.9267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8214   -9.2562    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.3659   -8.6469    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.9546   -7.9407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.0982   -8.1137    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.2811   -7.1948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0947   -7.1075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4242   -6.3605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9412   -5.7003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1249   -5.7919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7991   -6.5390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2660   -4.9536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.0934   -4.7795    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.1457   -3.9664    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.3974   -3.6378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8538   -4.2191    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   29.2329   -2.8374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8449   -2.2972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6810   -1.4974    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.9048   -1.2389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2924   -1.7863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.4595   -2.5841    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  2  7  1  0
  6  8  1  0
  8  9  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 10  1  0
  5 10  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
 13 15  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 21  1  0
 18 21  1  0
 24 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 26  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4542197

    ---

Associated Targets(Human)

GUSB Tchem Beta-glucuronidase (537 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 429.46Molecular Weight (Monoisotopic): 429.0896AlogP: 4.70#Rotatable Bonds: 5
Polar Surface Area: 107.05Molecular Species: NEUTRALHBA: 9HBD: 1
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 8.53CX Basic pKa: 3.87CX LogP: 3.15CX LogD: 3.12
Aromatic Rings: 5Heavy Atoms: 31QED Weighted: 0.43Np Likeness Score: -0.78

References

1. Taha M, Imran S, Alomari M, Rahim F, Wadood A, Mosaddik A, Uddin N, Gollapalli M, Alqahtani MA, Bamarouf YA..  (2019)  Synthesis of oxadiazole-coupled-thiadiazole derivatives as a potent β-glucuronidase inhibitors and their molecular docking study.,  27  (14): [PMID:31196753] [10.1016/j.bmc.2019.05.049]

Source