The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N,N'-(dodecane-1,12-diyl)bis(N'-methoxybenzimidamide) ID: ALA4542282
PubChem CID: 155551399
Max Phase: Preclinical
Molecular Formula: C28H42N4O2
Molecular Weight: 466.67
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CO/N=C(\NCCCCCCCCCCCCN/C(=N\OC)c1ccccc1)c1ccccc1
Standard InChI: InChI=1S/C28H42N4O2/c1-33-31-27(25-19-13-11-14-20-25)29-23-17-9-7-5-3-4-6-8-10-18-24-30-28(32-34-2)26-21-15-12-16-22-26/h11-16,19-22H,3-10,17-18,23-24H2,1-2H3,(H,29,31)(H,30,32)
Standard InChI Key: ANFPJGLWBVVYBH-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 35 0 0 0 0 0 0 0 0999 V2000
1.1319 -2.9958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1307 -3.8232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8456 -4.2360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5620 -3.8227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5591 -2.9921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8437 -2.5830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2721 -2.5770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9880 -2.9868 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.2689 -1.7520 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.9819 -1.3368 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.7010 -2.5715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4170 -2.9814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1299 -2.5662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8459 -2.9760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5588 -2.5608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2748 -2.9706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9878 -2.5554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7038 -2.9653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4167 -2.5500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1328 -2.9598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8456 -2.5447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5617 -2.9545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2745 -2.5392 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.9906 -2.9491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7034 -2.5339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9937 -3.7741 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.2808 -4.1892 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.4189 -2.9458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1314 -2.5313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1286 -1.7054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4076 -1.2958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6981 -1.7126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9788 -0.5118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5647 -3.7795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
5 7 1 0
7 8 1 0
7 9 2 0
9 10 1 0
8 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
24 26 2 0
26 27 1 0
25 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 25 1 0
10 33 1 0
27 34 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 466.67Molecular Weight (Monoisotopic): 466.3308AlogP: 6.08#Rotatable Bonds: 17Polar Surface Area: 67.24Molecular Species: NEUTRALHBA: 4HBD: 2#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 6.72CX LogP: 7.05CX LogD: 6.97Aromatic Rings: 2Heavy Atoms: 34QED Weighted: 0.13Np Likeness Score: -0.23
References 1. Berger O, Ortial S, Wein S, Denoyelle S, Bressolle F, Durand T, Escale R, Vial HJ, Vo-Hoang Y.. (2019) Evaluation of amidoxime derivatives as prodrug candidates of potent bis-cationic antimalarials., 29 (16): [PMID:31255483 ] [10.1016/j.bmcl.2019.06.045 ]