The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(Dimethylamino)-3,5-dinitro-N-(4-nitrophenyl)benzamide ID: ALA4542291
PubChem CID: 155551473
Max Phase: Preclinical
Molecular Formula: C15H13N5O7
Molecular Weight: 375.30
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CN(C)c1c([N+](=O)[O-])cc(C(=O)Nc2ccc([N+](=O)[O-])cc2)cc1[N+](=O)[O-]
Standard InChI: InChI=1S/C15H13N5O7/c1-17(2)14-12(19(24)25)7-9(8-13(14)20(26)27)15(21)16-10-3-5-11(6-4-10)18(22)23/h3-8H,1-2H3,(H,16,21)
Standard InChI Key: CVMWESIEZQCHKF-UHFFFAOYSA-N
Molfile:
RDKit 2D
27 28 0 0 0 0 0 0 0 0999 V2000
39.4590 -10.2768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.4579 -11.0963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.1659 -11.5053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.8756 -11.0958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.8727 -10.2732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.1641 -9.8679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.5789 -9.8619 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.2882 -10.2678 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
41.5758 -9.0447 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.1657 -12.3225 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.4579 -12.7309 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.8733 -12.7312 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.7512 -9.8683 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.7510 -9.0511 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.0436 -10.2771 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
42.9943 -9.8566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.7020 -10.2659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.4077 -9.8553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.4050 -9.0373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.6908 -8.6315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.9881 -9.0444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.7498 -11.5043 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.0425 -11.0952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.7492 -12.3215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.1106 -8.6251 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
45.8204 -9.0300 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
45.1065 -7.8079 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
5 7 1 0
7 8 1 0
7 9 2 0
3 10 1 0
10 11 1 0
10 12 2 0
1 13 1 0
13 14 1 0
13 15 2 0
8 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
2 22 1 0
22 23 1 0
22 24 1 0
19 25 1 0
25 26 1 0
25 27 2 0
M CHG 6 10 1 11 -1 13 1 14 -1 25 1 26 -1
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 375.30Molecular Weight (Monoisotopic): 375.0815AlogP: 2.73#Rotatable Bonds: 6Polar Surface Area: 161.76Molecular Species: NEUTRALHBA: 8HBD: 1#RO5 Violations: ┄HBA (Lipinski): 12HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.99CX Basic pKa: ┄CX LogP: 2.99CX LogD: 2.99Aromatic Rings: 2Heavy Atoms: 27QED Weighted: 0.59Np Likeness Score: -1.41
References 1. Güngör T, Önder FC, Tokay E, Gülhan ÜG, Hacıoğlu N, Tok TT, Çelik A, Köçkar F, Ay M.. (2019) PRODRUGS FOR NITROREDUCTASE BASED CANCER THERAPY- 2: Novel amide/Ntr combinations targeting PC3 cancer cells., 171 [PMID:30928710 ] [10.1016/j.ejmech.2019.03.035 ]